2-bromo-1-(2,5-dimethoxyphenyl)-2-methylpropan-1-one
Modify Date: 2026-06-28 18:44:05
2-bromo-1-(2,5-dimethoxyphenyl)-2-methylpropan-1-one structure
|
Common Name | 2-bromo-1-(2,5-dimethoxyphenyl)-2-methylpropan-1-one | ||
|---|---|---|---|---|
| CAS Number | 89654-18-2 | Molecular Weight | 287.15000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-bromo-1-(2,5-dimethoxyphenyl)-2-methylpropan-1-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H15BrO3 |
|---|---|
| Molecular Weight | 287.15000 |
| Exact Mass | 286.02000 |
| PSA | 35.53000 |
| LogP | 3.06000 |
| InChIKey | ULALIIHLCJWPRP-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c(C(=O)C(C)(C)Br)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 2-bromo-1-(2,5-dimethoxyphenyl)-2-methylpropan-1-one? |
| A: LogP of 2-bromo-1-(2,5-dimethoxyphenyl)-2-methylpropan-1-one is 3.06000. |
| Q: What is the English name of 2-bromo-1-(2,5-dimethoxyphenyl)-2-methylpropan-1-one? |
| A: The English name of 2-bromo-1-(2,5-dimethoxyphenyl)-2-methylpropan-1-one is 2-bromo-1-(2,5-dimethoxyphenyl)-2-methylpropan-1-one. |
| Q: What is the Chinese name of 89654-18-2? |
| A: Chinese name of 89654-18-2 is 89654-18-2. |
| Q: What is the molecular weight of 2-bromo-1-(2,5-dimethoxyphenyl)-2-methylpropan-1-one? |
| A: Molecular weight of 2-bromo-1-(2,5-dimethoxyphenyl)-2-methylpropan-1-one is 287.15000. |
| Q: What is the molecular formula of 2-bromo-1-(2,5-dimethoxyphenyl)-2-methylpropan-1-one? |
| A: Molecular formula of 2-bromo-1-(2,5-dimethoxyphenyl)-2-methylpropan-1-one is C12H15BrO3. |
| Q: What is the CAS number of 2-bromo-1-(2,5-dimethoxyphenyl)-2-methylpropan-1-one? |
| A: CAS number of 2-bromo-1-(2,5-dimethoxyphenyl)-2-methylpropan-1-one is 89654-18-2. |
| Q: What is the InChIKey of 2-bromo-1-(2,5-dimethoxyphenyl)-2-methylpropan-1-one? |
| A: InChIKey of 2-bromo-1-(2,5-dimethoxyphenyl)-2-methylpropan-1-one is ULALIIHLCJWPRP-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 2-bromo-1-(2,5-dimethoxyphenyl)-2-methylpropan-1-one? |
| A: Polar surface area (PSA) of 2-bromo-1-(2,5-dimethoxyphenyl)-2-methylpropan-1-one is 35.53000. |
| Q: What is the SMILES notation of 2-bromo-1-(2,5-dimethoxyphenyl)-2-methylpropan-1-one? |
| A: SMILES notation of 2-bromo-1-(2,5-dimethoxyphenyl)-2-methylpropan-1-one is COc1ccc(OC)c(C(=O)C(C)(C)Br)c1. |