1-(2,5-dimethoxyphenyl)-2-methoxy-2-phenylethanone
1-(2,5-dimethoxyphenyl)-2-methoxy-2-phenylethanone structure
|
Common Name | 1-(2,5-dimethoxyphenyl)-2-methoxy-2-phenylethanone | ||
|---|---|---|---|---|
| CAS Number | 89654-23-9 | Molecular Weight | 286.32200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2,5-dimethoxyphenyl)-2-methoxy-2-phenylethanone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H18O4 |
|---|---|
| Molecular Weight | 286.32200 |
| Exact Mass | 286.12100 |
| PSA | 44.76000 |
| LogP | 3.27420 |
| InChIKey | LCNNTPVXCXXGEV-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c(C(=O)C(OC)c2ccccc2)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~72%
1-(2,5-dimethox... CAS#:89654-23-9 |
| Literature: Izawa, Yasuji; Watoh, Yasushi; Tomioka, Hideo Chemistry Letters, 1984 , p. 33 - 36 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 1-(2,5-dimethoxyphenyl)-2-methoxy-2-phenylethanone? |
| A: Polar surface area (PSA) of 1-(2,5-dimethoxyphenyl)-2-methoxy-2-phenylethanone is 44.76000. |
| Q: What is the InChIKey of 1-(2,5-dimethoxyphenyl)-2-methoxy-2-phenylethanone? |
| A: InChIKey of 1-(2,5-dimethoxyphenyl)-2-methoxy-2-phenylethanone is LCNNTPVXCXXGEV-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1-(2,5-dimethoxyphenyl)-2-methoxy-2-phenylethanone? |
| A: Molecular weight of 1-(2,5-dimethoxyphenyl)-2-methoxy-2-phenylethanone is 286.32200. |
| Q: What is the molecular formula of 1-(2,5-dimethoxyphenyl)-2-methoxy-2-phenylethanone? |
| A: Molecular formula of 1-(2,5-dimethoxyphenyl)-2-methoxy-2-phenylethanone is C17H18O4. |
| Q: What is the LogP of 1-(2,5-dimethoxyphenyl)-2-methoxy-2-phenylethanone? |
| A: LogP of 1-(2,5-dimethoxyphenyl)-2-methoxy-2-phenylethanone is 3.27420. |
| Q: What is the English name of 1-(2,5-dimethoxyphenyl)-2-methoxy-2-phenylethanone? |
| A: The English name of 1-(2,5-dimethoxyphenyl)-2-methoxy-2-phenylethanone is 1-(2,5-dimethoxyphenyl)-2-methoxy-2-phenylethanone. |
| Q: What is the Chinese name of 89654-23-9? |
| A: Chinese name of 89654-23-9 is 89654-23-9. |
| Q: What is the SMILES notation of 1-(2,5-dimethoxyphenyl)-2-methoxy-2-phenylethanone? |
| A: SMILES notation of 1-(2,5-dimethoxyphenyl)-2-methoxy-2-phenylethanone is COc1ccc(OC)c(C(=O)C(OC)c2ccccc2)c1. |
| Q: What is the CAS number of 1-(2,5-dimethoxyphenyl)-2-methoxy-2-phenylethanone? |
| A: CAS number of 1-(2,5-dimethoxyphenyl)-2-methoxy-2-phenylethanone is 89654-23-9. |