bis(2-diphenylphosphanylethyl)-(2-diphenylphosphanyl-2-iodoethyl)-diiodo-λ5-phosphane,chromium structure
|
Common Name | bis(2-diphenylphosphanylethyl)-(2-diphenylphosphanyl-2-iodoethyl)-diiodo-λ5-phosphane,chromium | ||
|---|---|---|---|---|
| CAS Number | 89655-19-6 | Molecular Weight | 1102.38000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C42H41CrI3P4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(2-diphenylphosphanylethyl)-(2-diphenylphosphanyl-2-iodoethyl)-diiodo-λ5-phosphane,chromium |
|---|
| Molecular Formula | C42H41CrI3P4 |
|---|---|
| Molecular Weight | 1102.38000 |
| Exact Mass | 1101.87000 |
| PSA | 54.36000 |
| LogP | 11.39950 |
| InChIKey | WOCGFPYCWRPUOA-UHFFFAOYSA-N |
| SMILES | IC(CP(I)(I)(CCP(c1ccccc1)c1ccccc1)CCP(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1.[Cr] |
|
~%
bis(2-diphenylp... CAS#:89655-19-6 |
| Literature: Gray, Leslie R.; Hale, Anette L.; Levason, William; McCullough, Francis P.; Webster, Michael Journal of the Chemical Society, Dalton Transactions: Inorganic Chemistry (1972-1999), 1984 , p. 47 - 54 |