bis(2-diphenylphosphanylethyl)-(2-diphenylphosphanyl-2-iodoethyl)-diiodo-λ5-phosphane,chromium
bis(2-diphenylphosphanylethyl)-(2-diphenylphosphanyl-2-iodoethyl)-diiodo-λ5-phosphane,chromium structure
|
Common Name | bis(2-diphenylphosphanylethyl)-(2-diphenylphosphanyl-2-iodoethyl)-diiodo-λ5-phosphane,chromium | ||
|---|---|---|---|---|
| CAS Number | 89655-19-6 | Molecular Weight | 1102.38000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C42H41CrI3P4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | bis(2-diphenylphosphanylethyl)-(2-diphenylphosphanyl-2-iodoethyl)-diiodo-λ5-phosphane,chromium |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C42H41CrI3P4 |
|---|---|
| Molecular Weight | 1102.38000 |
| Exact Mass | 1101.87000 |
| PSA | 54.36000 |
| LogP | 11.39950 |
| InChIKey | WOCGFPYCWRPUOA-UHFFFAOYSA-N |
| SMILES | IC(CP(I)(I)(CCP(c1ccccc1)c1ccccc1)CCP(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1.[Cr] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
bis(2-diphenylp... CAS#:89655-19-6 |
| Literature: Gray, Leslie R.; Hale, Anette L.; Levason, William; McCullough, Francis P.; Webster, Michael Journal of the Chemical Society, Dalton Transactions: Inorganic Chemistry (1972-1999), 1984 , p. 47 - 54 |
![TRIS[2-(DIPHENYLPHOSPHINO)ETHYL]PHOSPHINE structure](https://image.chemsrc.com/caspic/493/23582-03-8.png)
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of bis(2-diphenylphosphanylethyl)-(2-diphenylphosphanyl-2-iodoethyl)-diiodo-λ5-phosphane,chromium? |
| A: SMILES notation of bis(2-diphenylphosphanylethyl)-(2-diphenylphosphanyl-2-iodoethyl)-diiodo-λ5-phosphane,chromium is IC(CP(I)(I)(CCP(c1ccccc1)c1ccccc1)CCP(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1.[Cr]. |
| Q: What is the molecular formula of bis(2-diphenylphosphanylethyl)-(2-diphenylphosphanyl-2-iodoethyl)-diiodo-λ5-phosphane,chromium? |
| A: Molecular formula of bis(2-diphenylphosphanylethyl)-(2-diphenylphosphanyl-2-iodoethyl)-diiodo-λ5-phosphane,chromium is C42H41CrI3P4. |
| Q: What is the InChIKey of bis(2-diphenylphosphanylethyl)-(2-diphenylphosphanyl-2-iodoethyl)-diiodo-λ5-phosphane,chromium? |
| A: InChIKey of bis(2-diphenylphosphanylethyl)-(2-diphenylphosphanyl-2-iodoethyl)-diiodo-λ5-phosphane,chromium is WOCGFPYCWRPUOA-UHFFFAOYSA-N. |
| Q: What is the CAS number of bis(2-diphenylphosphanylethyl)-(2-diphenylphosphanyl-2-iodoethyl)-diiodo-λ5-phosphane,chromium? |
| A: CAS number of bis(2-diphenylphosphanylethyl)-(2-diphenylphosphanyl-2-iodoethyl)-diiodo-λ5-phosphane,chromium is 89655-19-6. |
| Q: What is the LogP of bis(2-diphenylphosphanylethyl)-(2-diphenylphosphanyl-2-iodoethyl)-diiodo-λ5-phosphane,chromium? |
| A: LogP of bis(2-diphenylphosphanylethyl)-(2-diphenylphosphanyl-2-iodoethyl)-diiodo-λ5-phosphane,chromium is 11.39950. |
| Q: What is the molecular weight of bis(2-diphenylphosphanylethyl)-(2-diphenylphosphanyl-2-iodoethyl)-diiodo-λ5-phosphane,chromium? |
| A: Molecular weight of bis(2-diphenylphosphanylethyl)-(2-diphenylphosphanyl-2-iodoethyl)-diiodo-λ5-phosphane,chromium is 1102.38000. |
| Q: What is the Chinese name of 89655-19-6? |
| A: Chinese name of 89655-19-6 is 89655-19-6. |
| Q: What is the polar surface area (PSA) of bis(2-diphenylphosphanylethyl)-(2-diphenylphosphanyl-2-iodoethyl)-diiodo-λ5-phosphane,chromium? |
| A: Polar surface area (PSA) of bis(2-diphenylphosphanylethyl)-(2-diphenylphosphanyl-2-iodoethyl)-diiodo-λ5-phosphane,chromium is 54.36000. |
| Q: What is the English name of bis(2-diphenylphosphanylethyl)-(2-diphenylphosphanyl-2-iodoethyl)-diiodo-λ5-phosphane,chromium? |
| A: The English name of bis(2-diphenylphosphanylethyl)-(2-diphenylphosphanyl-2-iodoethyl)-diiodo-λ5-phosphane,chromium is bis(2-diphenylphosphanylethyl)-(2-diphenylphosphanyl-2-iodoethyl)-diiodo-λ5-phosphane,chromium. |