10-benzylidene-1,5λ4-dithiaspiro[5.5]undecane 5-oxide
![10-benzylidene-1,5λ4-dithiaspiro[5.5]undecane 5-oxide Structure](https://image.chemsrc.com/caspic/197/89655-99-2.png)
10-benzylidene-1,5λ4-dithiaspiro[5.5]undecane 5-oxide structure
|
Common Name | 10-benzylidene-1,5λ4-dithiaspiro[5.5]undecane 5-oxide | ||
|---|---|---|---|---|
| CAS Number | 89655-99-2 | Molecular Weight | 292.45900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H20OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 10-benzylidene-1,5λ4-dithiaspiro[5.5]undecane 5-oxide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H20OS2 |
|---|---|
| Molecular Weight | 292.45900 |
| Exact Mass | 292.09600 |
| PSA | 61.58000 |
| LogP | 5.09160 |
| InChIKey | XNEXYRCVIVZWNG-UHFFFAOYSA-N |
| SMILES | O=S1CCCSC12CCCC(=Cc1ccccc1)C2 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
10-benzylidene-... CAS#:89655-99-2 |
| Literature: Cristau, H. J.; Chabaud, B.; Christol, H. Journal of Organic Chemistry, 1984 , vol. 49, # 11 p. 2023 - 2025 |
![(5-oxo-1,5λ4-dithiaspiro[5.5]undecan-10-yl)-triphenylphosphanium,nitrate structure](https://image.chemsrc.com/caspic/138/89637-45-6.png)
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 89655-99-2? |
| A: Chinese name of 89655-99-2 is 89655-99-2. |
| Q: What is the molecular weight of 10-benzylidene-1,5λ4-dithiaspiro[5.5]undecane 5-oxide? |
| A: Molecular weight of 10-benzylidene-1,5λ4-dithiaspiro[5.5]undecane 5-oxide is 292.45900. |
| Q: What is the English name of 10-benzylidene-1,5λ4-dithiaspiro[5.5]undecane 5-oxide? |
| A: The English name of 10-benzylidene-1,5λ4-dithiaspiro[5.5]undecane 5-oxide is 10-benzylidene-1,5λ4-dithiaspiro[5.5]undecane 5-oxide. |
| Q: What is the InChIKey of 10-benzylidene-1,5λ4-dithiaspiro[5.5]undecane 5-oxide? |
| A: InChIKey of 10-benzylidene-1,5λ4-dithiaspiro[5.5]undecane 5-oxide is XNEXYRCVIVZWNG-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 10-benzylidene-1,5λ4-dithiaspiro[5.5]undecane 5-oxide? |
| A: SMILES notation of 10-benzylidene-1,5λ4-dithiaspiro[5.5]undecane 5-oxide is O=S1CCCSC12CCCC(=Cc1ccccc1)C2. |
| Q: What is the CAS number of 10-benzylidene-1,5λ4-dithiaspiro[5.5]undecane 5-oxide? |
| A: CAS number of 10-benzylidene-1,5λ4-dithiaspiro[5.5]undecane 5-oxide is 89655-99-2. |
| Q: What is the molecular formula of 10-benzylidene-1,5λ4-dithiaspiro[5.5]undecane 5-oxide? |
| A: Molecular formula of 10-benzylidene-1,5λ4-dithiaspiro[5.5]undecane 5-oxide is C16H20OS2. |
| Q: What is the polar surface area (PSA) of 10-benzylidene-1,5λ4-dithiaspiro[5.5]undecane 5-oxide? |
| A: Polar surface area (PSA) of 10-benzylidene-1,5λ4-dithiaspiro[5.5]undecane 5-oxide is 61.58000. |
| Q: What is the LogP of 10-benzylidene-1,5λ4-dithiaspiro[5.5]undecane 5-oxide? |
| A: LogP of 10-benzylidene-1,5λ4-dithiaspiro[5.5]undecane 5-oxide is 5.09160. |