N-tert-butyl-1-(2-phenylselanylpyrrolidin-1-yl)methanimine structure
|
Common Name | N-tert-butyl-1-(2-phenylselanylpyrrolidin-1-yl)methanimine | ||
|---|---|---|---|---|
| CAS Number | 89656-34-8 | Molecular Weight | 309.30900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H22N2Se | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-tert-butyl-1-(2-phenylselanylpyrrolidin-1-yl)methanimine |
|---|
| Molecular Formula | C15H22N2Se |
|---|---|
| Molecular Weight | 309.30900 |
| Exact Mass | 310.09500 |
| PSA | 15.60000 |
| LogP | 2.62260 |
| InChIKey | XTHZYCDOJQTUHJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N=CN1CCCC1[Se]c1ccccc1 |
|
~%
N-tert-butyl-1-... CAS#:89656-34-8 |
| Literature: Meyers,A.I.; Edwards,P.D.; Rieker,W.F. Journal of the American Chemical Society, 1984 , vol. 106, p. 3270 |
|
~%
N-tert-butyl-1-... CAS#:89656-34-8 |
| Literature: Meyers, A. I.; Edwards, Philip D.; Bailey, Thomas R.; Jagdmann, G. Erik Journal of Organic Chemistry, 1985 , vol. 50, # 7 p. 1019 - 1026 |