N-tert-butyl-1-(2-heptylazepan-1-yl)methanimine
N-tert-butyl-1-(2-heptylazepan-1-yl)methanimine structure
|
Common Name | N-tert-butyl-1-(2-heptylazepan-1-yl)methanimine | ||
|---|---|---|---|---|
| CAS Number | 89656-46-2 | Molecular Weight | 280.49200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H36N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-tert-butyl-1-(2-heptylazepan-1-yl)methanimine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H36N2 |
|---|---|
| Molecular Weight | 280.49200 |
| Exact Mass | 280.28800 |
| PSA | 15.60000 |
| LogP | 5.35620 |
| InChIKey | UKPIACIAIFINCT-UHFFFAOYSA-N |
| SMILES | CCCCCCCC1CCCCCN1C=NC(C)(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
N-tert-butyl-1-... CAS#:89656-46-2 |
| Literature: Meyers,A.I.; Edwards,P.D.; Rieker,W.F. Journal of the American Chemical Society, 1984 , vol. 106, p. 3270 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of N-tert-butyl-1-(2-heptylazepan-1-yl)methanimine? |
| A: Molecular formula of N-tert-butyl-1-(2-heptylazepan-1-yl)methanimine is C18H36N2. |
| Q: What is the polar surface area (PSA) of N-tert-butyl-1-(2-heptylazepan-1-yl)methanimine? |
| A: Polar surface area (PSA) of N-tert-butyl-1-(2-heptylazepan-1-yl)methanimine is 15.60000. |
| Q: What is the LogP of N-tert-butyl-1-(2-heptylazepan-1-yl)methanimine? |
| A: LogP of N-tert-butyl-1-(2-heptylazepan-1-yl)methanimine is 5.35620. |
| Q: What is the molecular weight of N-tert-butyl-1-(2-heptylazepan-1-yl)methanimine? |
| A: Molecular weight of N-tert-butyl-1-(2-heptylazepan-1-yl)methanimine is 280.49200. |
| Q: What is the Chinese name of 89656-46-2? |
| A: Chinese name of 89656-46-2 is 89656-46-2. |
| Q: What is the SMILES notation of N-tert-butyl-1-(2-heptylazepan-1-yl)methanimine? |
| A: SMILES notation of N-tert-butyl-1-(2-heptylazepan-1-yl)methanimine is CCCCCCCC1CCCCCN1C=NC(C)(C)C. |
| Q: What is the InChIKey of N-tert-butyl-1-(2-heptylazepan-1-yl)methanimine? |
| A: InChIKey of N-tert-butyl-1-(2-heptylazepan-1-yl)methanimine is UKPIACIAIFINCT-UHFFFAOYSA-N. |
| Q: What is the CAS number of N-tert-butyl-1-(2-heptylazepan-1-yl)methanimine? |
| A: CAS number of N-tert-butyl-1-(2-heptylazepan-1-yl)methanimine is 89656-46-2. |
| Q: What is the English name of N-tert-butyl-1-(2-heptylazepan-1-yl)methanimine? |
| A: The English name of N-tert-butyl-1-(2-heptylazepan-1-yl)methanimine is N-tert-butyl-1-(2-heptylazepan-1-yl)methanimine. |