methyl 3-(4-chlorophenyl)-2-methyl-4-thioxo-3,4,5,6-tetrahydro-2H-2,6-methano-1,3,5-benzoxadiazocine-8-carboxylate structure
|
Common Name | methyl 3-(4-chlorophenyl)-2-methyl-4-thioxo-3,4,5,6-tetrahydro-2H-2,6-methano-1,3,5-benzoxadiazocine-8-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 896705-27-4 | Molecular Weight | 388.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H17ClN2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 3-(4-chlorophenyl)-2-methyl-4-thioxo-3,4,5,6-tetrahydro-2H-2,6-methano-1,3,5-benzoxadiazocine-8-carboxylate |
|---|
| Molecular Formula | C19H17ClN2O3S |
|---|---|
| Molecular Weight | 388.9 |
| InChIKey | NEUOQDOJIWUAGZ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc2c(c1)C1CC(C)(O2)N(c2ccc(Cl)cc2)C(=S)N1 |
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|