4-[3-(trifluoromethyl)phenyl]-1,2,4-triazole-3,5-dione
Modify Date: 2025-11-26 09:30:40
![4-[3-(trifluoromethyl)phenyl]-1,2,4-triazole-3,5-dione Structure](https://image.chemsrc.com/caspic/439/89676-71-1.png)
4-[3-(trifluoromethyl)phenyl]-1,2,4-triazole-3,5-dione structure
|
Common Name | 4-[3-(trifluoromethyl)phenyl]-1,2,4-triazole-3,5-dione | ||
|---|---|---|---|---|
| CAS Number | 89676-71-1 | Molecular Weight | 243.14200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H4F3N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[3-(trifluoromethyl)phenyl]-1,2,4-triazole-3,5-dione |
|---|
| Molecular Formula | C9H4F3N3O2 |
|---|---|
| Molecular Weight | 243.14200 |
| Exact Mass | 243.02600 |
| PSA | 62.10000 |
| LogP | 2.15380 |
| InChIKey | UJUUIFAYJQXKSY-UHFFFAOYSA-N |
| SMILES | O=C1N=NC(=O)N1c1cccc(C(F)(F)F)c1 |
|
~%
4-[3-(trifluoro... CAS#:89676-71-1 |
| Literature: Adam,W.; Carballeira,N. Journal of the American Chemical Society, 1984 , vol. 106, p. 2874 |
|
~%
4-[3-(trifluoro... CAS#:89676-71-1 |
| Literature: Adam,W.; Carballeira,N. Journal of the American Chemical Society, 1984 , vol. 106, p. 2874 |
