4-(Chloromethyl)-1,2-dinitrobenzene structure
|
Common Name | 4-(Chloromethyl)-1,2-dinitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 89692-62-6 | Molecular Weight | 216.57900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H5ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(Chloromethyl)-1,2-dinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H5ClN2O4 |
|---|---|
| Molecular Weight | 216.57900 |
| Exact Mass | 215.99400 |
| PSA | 91.64000 |
| LogP | 3.28820 |
| InChIKey | VQQWPESNVPHXEM-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(CCl)cc1[N+](=O)[O-] |
| HS Code | 2904909090 |
|---|
|
~%
4-(Chloromethyl... CAS#:89692-62-6 |
| Literature: Fuchs,R.; Carlton,D.M. Journal of Organic Chemistry, 1962 , vol. 27, p. 1520 - 1523 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| p-dimethyl amino benzoic acid |
| 3,4-dimethylanthranilic acid |
| 3,4-Dinitrobenzyl chloride |
| 2-Amino-3.4-dimethyl-benzoesaeure |
| 3,4-Dinitro-1-chlormethyl-benzol |
| 2-AMINO-3,4-DIMETHYL-BENZOIC ACID |
| 3,4-dinethylanthranilic acid |