1,1,3,3-tetraoxo-1,3-dithiocan-5-one structure
|
Common Name | 1,1,3,3-tetraoxo-1,3-dithiocan-5-one | ||
|---|---|---|---|---|
| CAS Number | 89717-42-0 | Molecular Weight | 226.27100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H10O5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,3,3-tetraoxo-1,3-dithiocan-5-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H10O5S2 |
|---|---|
| Molecular Weight | 226.27100 |
| Exact Mass | 225.99700 |
| PSA | 102.11000 |
| LogP | 1.29800 |
| InChIKey | UPVNOIGASRDQCA-UHFFFAOYSA-N |
| SMILES | O=C1CCCS(=O)(=O)CS(=O)(=O)C1 |
|
~%
1,1,3,3-tetraox... CAS#:89717-42-0 |
| Literature: Fatutta, Silvana; Pitacco, Giuliana; Valentin, Ennio Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 11 p. 2735 - 2738 |
|
~%
1,1,3,3-tetraox... CAS#:89717-42-0 |
| Literature: Fatutta, Silvana; Pitacco, Giuliana; Valentin, Ennio Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 11 p. 2735 - 2738 |
| 1,3-Dithiocan-5-one,1,1,3,3-tetraoxide |
| 1,3-dithiacyclo-octan-5-one 1,1,3,3-tetraoxide |