5-ethoxy-2-methyl-4-nitro-1,3-thiazole structure
|
Common Name | 5-ethoxy-2-methyl-4-nitro-1,3-thiazole | ||
|---|---|---|---|---|
| CAS Number | 89717-60-2 | Molecular Weight | 188.20400 | |
| Density | 1.337g/cm3 | Boiling Point | 309.6ºC at 760 mmHg | |
| Molecular Formula | C6H8N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.1ºC | |
| Name | 5-ethoxy-2-methyl-4-nitro-1,3-thiazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.337g/cm3 |
|---|---|
| Boiling Point | 309.6ºC at 760 mmHg |
| Molecular Formula | C6H8N2O3S |
| Molecular Weight | 188.20400 |
| Flash Point | 141.1ºC |
| Exact Mass | 188.02600 |
| PSA | 96.18000 |
| LogP | 2.28160 |
| Index of Refraction | 1.558 |
| InChIKey | YJQRKOOFNFWLHZ-UHFFFAOYSA-N |
| SMILES | CCOc1sc(C)nc1[N+](=O)[O-] |
|
~%
5-ethoxy-2-meth... CAS#:89717-60-2 |
| Literature: Tarbell et al. Journal of the American Chemical Society, 1950 , vol. 72, p. 3138 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-Aethoxy-2-methyl-4-nitro-thiazol |
| 5-ethoxy-2-methyl-4-nitro-thiazole |