bis(4-bromo-2-methylpyrazol-3-yl)diazene structure
|
Common Name | bis(4-bromo-2-methylpyrazol-3-yl)diazene | ||
|---|---|---|---|---|
| CAS Number | 89717-69-1 | Molecular Weight | 347.99700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8Br2N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(4-bromo-2-methylpyrazol-3-yl)diazene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H8Br2N6 |
|---|---|
| Molecular Weight | 347.99700 |
| Exact Mass | 345.91800 |
| PSA | 60.36000 |
| LogP | 3.09400 |
| InChIKey | WIONWQDGVAVWSA-UHFFFAOYSA-N |
| SMILES | Cn1ncc(Br)c1N=Nc1c(Br)cnn1C |
|
~13%
bis(4-bromo-2-m... CAS#:89717-69-1 |
| Literature: Newton, Christopher G.; Ollis, W. David; Podmore, Michael L.; Wright, Derek E. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 1 p. 63 - 67 |
| 4,4'-dibromo-1,1'-dimethyl-5,5'-azopyrazole |