2-[2-(3-chlorophenyl)ethenyl]-5-methyl-1,3-oxazole-4-carboxylic acid structure
|
Common Name | 2-[2-(3-chlorophenyl)ethenyl]-5-methyl-1,3-oxazole-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 89724-04-9 | Molecular Weight | 263.67600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[2-(3-chlorophenyl)ethenyl]-5-methyl-1,3-oxazole-4-carboxylic acid |
|---|
| Molecular Formula | C13H10ClNO3 |
|---|---|
| Molecular Weight | 263.67600 |
| Exact Mass | 263.03500 |
| PSA | 63.33000 |
| LogP | 3.50500 |
| InChIKey | YSRMDHWZHYKFPL-AATRIKPKSA-N |
| SMILES | Cc1oc(C=Cc2cccc(Cl)c2)nc1C(=O)O |
|
~96%
2-[2-(3-chlorop... CAS#:89724-04-9 |
| Literature: Meguro; Tawada; Sugiyama; Fujita; Kawamatsu Chemical and Pharmaceutical Bulletin, 1986 , vol. 34, # 7 p. 2840 - 2851 |
|
~%
2-[2-(3-chlorop... CAS#:89724-04-9 |
| Literature: Meguro; Tawada; Sugiyama; Fujita; Kawamatsu Chemical and Pharmaceutical Bulletin, 1986 , vol. 34, # 7 p. 2840 - 2851 |
|
~%
2-[2-(3-chlorop... CAS#:89724-04-9 |
| Literature: Meguro; Tawada; Sugiyama; Fujita; Kawamatsu Chemical and Pharmaceutical Bulletin, 1986 , vol. 34, # 7 p. 2840 - 2851 |