5-methyl-2-(1-methylcyclohexyl)-1,3-oxazole-4-carboxylic acid
5-methyl-2-(1-methylcyclohexyl)-1,3-oxazole-4-carboxylic acid structure
|
Common Name | 5-methyl-2-(1-methylcyclohexyl)-1,3-oxazole-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 89724-33-4 | Molecular Weight | 223.26800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 5-Methyl-2-(1-methylcyclohexyl)-1,3-oxazole-4-carboxylic acid (CAS: 89724-33-4), molecular formula: C12H17NO3, molecular weight: 223.27. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-methyl-2-(1-methylcyclohexyl)-1,3-oxazole-4-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H17NO3 |
|---|---|
| Molecular Weight | 223.26800 |
| Exact Mass | 223.12100 |
| PSA | 63.33000 |
| LogP | 2.90300 |
| InChIKey | QETQOVGQOIEHNU-UHFFFAOYSA-N |
| SMILES | Cc1oc(C2(C)CCCCC2)nc1C(=O)O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~83%
5-methyl-2-(1-m... CAS#:89724-33-4 |
| Literature: Meguro; Tawada; Sugiyama; Fujita; Kawamatsu Chemical and Pharmaceutical Bulletin, 1986 , vol. 34, # 7 p. 2840 - 2851 |
|
~%
5-methyl-2-(1-m... CAS#:89724-33-4 |
| Literature: Meguro; Tawada; Sugiyama; Fujita; Kawamatsu Chemical and Pharmaceutical Bulletin, 1986 , vol. 34, # 7 p. 2840 - 2851 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 5-methyl-2-(1-methylcyclohexyl)-1,3-oxazole-4-carboxylic acid? |
| A: LogP of 5-methyl-2-(1-methylcyclohexyl)-1,3-oxazole-4-carboxylic acid is 2.90300. |
| Q: What is the molecular weight of 5-methyl-2-(1-methylcyclohexyl)-1,3-oxazole-4-carboxylic acid? |
| A: Molecular weight of 5-methyl-2-(1-methylcyclohexyl)-1,3-oxazole-4-carboxylic acid is 223.26800. |
| Q: What is the Chinese name of 89724-33-4? |
| A: Chinese name of 89724-33-4 is 89724-33-4. |
| Q: What is the polar surface area (PSA) of 5-methyl-2-(1-methylcyclohexyl)-1,3-oxazole-4-carboxylic acid? |
| A: Polar surface area (PSA) of 5-methyl-2-(1-methylcyclohexyl)-1,3-oxazole-4-carboxylic acid is 63.33000. |
| Q: What is the InChIKey of 5-methyl-2-(1-methylcyclohexyl)-1,3-oxazole-4-carboxylic acid? |
| A: InChIKey of 5-methyl-2-(1-methylcyclohexyl)-1,3-oxazole-4-carboxylic acid is QETQOVGQOIEHNU-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 5-methyl-2-(1-methylcyclohexyl)-1,3-oxazole-4-carboxylic acid? |
| A: SMILES notation of 5-methyl-2-(1-methylcyclohexyl)-1,3-oxazole-4-carboxylic acid is Cc1oc(C2(C)CCCCC2)nc1C(=O)O. |
| Q: What is the CAS number of 5-methyl-2-(1-methylcyclohexyl)-1,3-oxazole-4-carboxylic acid? |
| A: CAS number of 5-methyl-2-(1-methylcyclohexyl)-1,3-oxazole-4-carboxylic acid is 89724-33-4. |
| Q: What is the molecular formula of 5-methyl-2-(1-methylcyclohexyl)-1,3-oxazole-4-carboxylic acid? |
| A: Molecular formula of 5-methyl-2-(1-methylcyclohexyl)-1,3-oxazole-4-carboxylic acid is C12H17NO3. |
| Q: What is the English name of 5-methyl-2-(1-methylcyclohexyl)-1,3-oxazole-4-carboxylic acid? |
| A: The English name of 5-methyl-2-(1-methylcyclohexyl)-1,3-oxazole-4-carboxylic acid is 5-methyl-2-(1-methylcyclohexyl)-1,3-oxazole-4-carboxylic acid. |