tributyl-[1-(methoxymethoxy)cyclohexyl]stannane structure
|
Common Name | tributyl-[1-(methoxymethoxy)cyclohexyl]stannane | ||
|---|---|---|---|---|
| CAS Number | 89727-03-7 | Molecular Weight | 433.24700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H42O2Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tributyl-[1-(methoxymethoxy)cyclohexyl]stannane |
|---|
| Molecular Formula | C20H42O2Sn |
|---|---|
| Molecular Weight | 433.24700 |
| Exact Mass | 434.22100 |
| PSA | 18.46000 |
| LogP | 6.29760 |
| InChIKey | VTFJOMAIQKPZMG-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)C1(OCOC)CCCCC1 |
|
~61%
tributyl-[1-(me... CAS#:89727-03-7 |
| Literature: Sawyer,J.S.; Kucerovy,A.; Macdonald,T.L. Journal of the American Chemical Society, 1988 , vol. 110, p. 842 |
|
~88%
tributyl-[1-(me... CAS#:89727-03-7 |
| Literature: Sawyer,J.S.; Kucerovy,A.; Macdonald,T.L. Journal of the American Chemical Society, 1988 , vol. 110, p. 842 |