2-nonylsulfonylcyclohexan-1-one
2-nonylsulfonylcyclohexan-1-one structure
|
Common Name | 2-nonylsulfonylcyclohexan-1-one | ||
|---|---|---|---|---|
| CAS Number | 89730-08-5 | Molecular Weight | 288.44600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H28O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2-Nonylsulfonylcyclohexan-1-one (CAS number: 89730-08-5, molecular formula: C15H28O3S, molecular weight: 288.44600), for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-nonylsulfonylcyclohexan-1-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H28O3S |
|---|---|
| Molecular Weight | 288.44600 |
| Exact Mass | 288.17600 |
| PSA | 59.59000 |
| LogP | 4.74430 |
| InChIKey | XIWXGGLHDDABOQ-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCS(=O)(=O)C1CCCCC1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-nonylsulfonyl... CAS#:89730-08-5 |
| Literature: Scholz, Dieter Liebigs Annalen der Chemie, 1984 , # 2 p. 264 - 272 |
|
~%
2-nonylsulfonyl... CAS#:89730-08-5 |
| Literature: Scholz, Dieter Liebigs Annalen der Chemie, 1984 , # 2 p. 264 - 272 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-nonylsulfonylcyclohexan-1-one? |
| A: The English name of 2-nonylsulfonylcyclohexan-1-one is 2-nonylsulfonylcyclohexan-1-one. |
| Q: What is the CAS number of 2-nonylsulfonylcyclohexan-1-one? |
| A: CAS number of 2-nonylsulfonylcyclohexan-1-one is 89730-08-5. |
| Q: What is the SMILES notation of 2-nonylsulfonylcyclohexan-1-one? |
| A: SMILES notation of 2-nonylsulfonylcyclohexan-1-one is CCCCCCCCCS(=O)(=O)C1CCCCC1=O. |
| Q: What is the molecular formula of 2-nonylsulfonylcyclohexan-1-one? |
| A: Molecular formula of 2-nonylsulfonylcyclohexan-1-one is C15H28O3S. |
| Q: What is the Chinese name of 89730-08-5? |
| A: Chinese name of 89730-08-5 is 89730-08-5. |
| Q: What is the polar surface area (PSA) of 2-nonylsulfonylcyclohexan-1-one? |
| A: Polar surface area (PSA) of 2-nonylsulfonylcyclohexan-1-one is 59.59000. |
| Q: What is the InChIKey of 2-nonylsulfonylcyclohexan-1-one? |
| A: InChIKey of 2-nonylsulfonylcyclohexan-1-one is XIWXGGLHDDABOQ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-nonylsulfonylcyclohexan-1-one? |
| A: Molecular weight of 2-nonylsulfonylcyclohexan-1-one is 288.44600. |
| Q: What is the LogP of 2-nonylsulfonylcyclohexan-1-one? |
| A: LogP of 2-nonylsulfonylcyclohexan-1-one is 4.74430. |