2-(3-bromo-3-methylsulfonylpropyl)benzoic acid structure
|
Common Name | 2-(3-bromo-3-methylsulfonylpropyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 89730-22-3 | Molecular Weight | 321.18800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13BrO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2-(3-bromo-3-methylsulfonylpropyl)benzoic acid (CAS: 89730-22-3) is a chemical compound with molecular formula C11H13BrO4S and molecular weight 321.18800. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(3-bromo-3-methylsulfonylpropyl)benzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H13BrO4S |
|---|---|
| Molecular Weight | 321.18800 |
| Exact Mass | 319.97200 |
| PSA | 79.82000 |
| LogP | 3.16380 |
| InChIKey | GLIUJGWGWXZRQR-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C(Br)CCc1ccccc1C(=O)O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~96%
2-(3-bromo-3-me... CAS#:89730-22-3 |
| Literature: Scholz, Dieter Liebigs Annalen der Chemie, 1984 , # 2 p. 264 - 272 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-(3-bromo-3-methylsulfonylpropyl)benzoic acid? |
| A: Molecular formula of 2-(3-bromo-3-methylsulfonylpropyl)benzoic acid is C11H13BrO4S. |
| Q: What is the molecular weight of 2-(3-bromo-3-methylsulfonylpropyl)benzoic acid? |
| A: Molecular weight of 2-(3-bromo-3-methylsulfonylpropyl)benzoic acid is 321.18800. |
| Q: What is the LogP of 2-(3-bromo-3-methylsulfonylpropyl)benzoic acid? |
| A: LogP of 2-(3-bromo-3-methylsulfonylpropyl)benzoic acid is 3.16380. |
| Q: What is the Chinese name of 89730-22-3? |
| A: Chinese name of 89730-22-3 is 89730-22-3. |
| Q: What is the English name of 2-(3-bromo-3-methylsulfonylpropyl)benzoic acid? |
| A: The English name of 2-(3-bromo-3-methylsulfonylpropyl)benzoic acid is 2-(3-bromo-3-methylsulfonylpropyl)benzoic acid. |
| Q: What is the CAS number of 2-(3-bromo-3-methylsulfonylpropyl)benzoic acid? |
| A: CAS number of 2-(3-bromo-3-methylsulfonylpropyl)benzoic acid is 89730-22-3. |
| Q: What is the polar surface area (PSA) of 2-(3-bromo-3-methylsulfonylpropyl)benzoic acid? |
| A: Polar surface area (PSA) of 2-(3-bromo-3-methylsulfonylpropyl)benzoic acid is 79.82000. |
| Q: What is the InChIKey of 2-(3-bromo-3-methylsulfonylpropyl)benzoic acid? |
| A: InChIKey of 2-(3-bromo-3-methylsulfonylpropyl)benzoic acid is GLIUJGWGWXZRQR-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-(3-bromo-3-methylsulfonylpropyl)benzoic acid? |
| A: SMILES notation of 2-(3-bromo-3-methylsulfonylpropyl)benzoic acid is CS(=O)(=O)C(Br)CCc1ccccc1C(=O)O. |