3-chloro-N-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]propanamide structure
|
Common Name | 3-chloro-N-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]propanamide | ||
|---|---|---|---|---|
| CAS Number | 89757-62-0 | Molecular Weight | 281.69500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-chloro-N-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]propanamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H12ClN3O3 |
|---|---|
| Molecular Weight | 281.69500 |
| Exact Mass | 281.05700 |
| PSA | 80.74000 |
| LogP | 2.96210 |
| InChIKey | BJAZREPMQUENLD-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2nnc(NC(=O)CCCl)o2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~76%
3-chloro-N-[5-(... CAS#:89757-62-0 |
| Literature: Saxena, V. K.; Singh, A. R.; Agarwal, R. K.; Mehra, S. C. Journal of the Indian Chemical Society, 1983 , vol. 60, p. 575 - 577 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 3-chloro-N-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]propanamide? |
| A: LogP of 3-chloro-N-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]propanamide is 2.96210. |
| Q: What is the CAS number of 3-chloro-N-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]propanamide? |
| A: CAS number of 3-chloro-N-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]propanamide is 89757-62-0. |
| Q: What is the InChIKey of 3-chloro-N-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]propanamide? |
| A: InChIKey of 3-chloro-N-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]propanamide is BJAZREPMQUENLD-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-chloro-N-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]propanamide? |
| A: Molecular weight of 3-chloro-N-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]propanamide is 281.69500. |
| Q: What is the polar surface area (PSA) of 3-chloro-N-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]propanamide? |
| A: Polar surface area (PSA) of 3-chloro-N-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]propanamide is 80.74000. |
| Q: What is the English name of 3-chloro-N-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]propanamide? |
| A: The English name of 3-chloro-N-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]propanamide is 3-chloro-N-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]propanamide. |
| Q: What is the SMILES notation of 3-chloro-N-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]propanamide? |
| A: SMILES notation of 3-chloro-N-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]propanamide is COc1ccc(-c2nnc(NC(=O)CCCl)o2)cc1. |
| Q: What is the Chinese name of 89757-62-0? |
| A: Chinese name of 89757-62-0 is 89757-62-0. |
| Q: What is the molecular formula of 3-chloro-N-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]propanamide? |
| A: Molecular formula of 3-chloro-N-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]propanamide is C12H12ClN3O3. |