3-(phenylmethoxycarbonylaminomethyl)benzoic acid
Modify Date: 2026-07-06 10:16:43
3-(phenylmethoxycarbonylaminomethyl)benzoic acid structure
|
Common Name | 3-(phenylmethoxycarbonylaminomethyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 89760-77-0 | Molecular Weight | 285.29500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(phenylmethoxycarbonylaminomethyl)benzoic acid |
|---|
| Molecular Formula | C16H15NO4 |
|---|---|
| Molecular Weight | 285.29500 |
| Exact Mass | 285.10000 |
| PSA | 79.12000 |
| LogP | 3.01560 |
| InChIKey | AGQWCHWQAOECIH-UHFFFAOYSA-N |
| SMILES | O=C(NCc1cccc(C(=O)O)c1)OCc1ccccc1 |
|
~96%
3-(phenylmethox... CAS#:89760-77-0 |
| Literature: Stewart, Frederick H. C. Australian Journal of Chemistry, 1983 , vol. 36, # 12 p. 2511 - 2516 |
|
~49%
3-(phenylmethox... CAS#:89760-77-0 |
| Literature: Clift, Michael D.; Silverman, Richard B. Bioorganic and Medicinal Chemistry Letters, 2008 , vol. 18, # 10 p. 3122 - 3125 |
