3-(furan-2-yl)-4,4,5,5-tetramethyl-1,2-thiazole
3-(furan-2-yl)-4,4,5,5-tetramethyl-1,2-thiazole structure
|
Common Name | 3-(furan-2-yl)-4,4,5,5-tetramethyl-1,2-thiazole | ||
|---|---|---|---|---|
| CAS Number | 89767-75-9 | Molecular Weight | 209.30800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(furan-2-yl)-4,4,5,5-tetramethyl-1,2-thiazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H15NOS |
|---|---|
| Molecular Weight | 209.30800 |
| Exact Mass | 209.08700 |
| PSA | 50.80000 |
| LogP | 2.97090 |
| InChIKey | VYSWAQNXJUXAFS-UHFFFAOYSA-N |
| SMILES | CC1(C)SN=C(c2ccco2)C1(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~25%
3-(furan-2-yl)-... CAS#:89767-75-9 |
| Literature: Machida, Minoru; Oda, Kazuaki; Kanaoka, Yuichi Tetrahedron Letters, 1984 , vol. 25, # 4 p. 409 - 410 |
|
~%
3-(furan-2-yl)-... CAS#:89767-75-9 |
| Literature: Oda, Kazuaki; Machida, Minoru; Kanaoka, Yuichi Heterocycles, 1984 , vol. 21, # 2 p. 622 |
|
~%
Detail
Learn More
|
| Literature: Oda, Kazuaki; Machida, Minoru; Kanaoka, Yuichi Heterocycles, 1984 , vol. 21, # 2 p. 622 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3-(furan-2-yl)-4,4,5,5-tetramethyl-1,2-thiazole? |
| A: The English name of 3-(furan-2-yl)-4,4,5,5-tetramethyl-1,2-thiazole is 3-(furan-2-yl)-4,4,5,5-tetramethyl-1,2-thiazole. |
| Q: What is the CAS number of 3-(furan-2-yl)-4,4,5,5-tetramethyl-1,2-thiazole? |
| A: CAS number of 3-(furan-2-yl)-4,4,5,5-tetramethyl-1,2-thiazole is 89767-75-9. |
| Q: What is the molecular weight of 3-(furan-2-yl)-4,4,5,5-tetramethyl-1,2-thiazole? |
| A: Molecular weight of 3-(furan-2-yl)-4,4,5,5-tetramethyl-1,2-thiazole is 209.30800. |
| Q: What is the InChIKey of 3-(furan-2-yl)-4,4,5,5-tetramethyl-1,2-thiazole? |
| A: InChIKey of 3-(furan-2-yl)-4,4,5,5-tetramethyl-1,2-thiazole is VYSWAQNXJUXAFS-UHFFFAOYSA-N. |
| Q: What is the LogP of 3-(furan-2-yl)-4,4,5,5-tetramethyl-1,2-thiazole? |
| A: LogP of 3-(furan-2-yl)-4,4,5,5-tetramethyl-1,2-thiazole is 2.97090. |
| Q: What is the molecular formula of 3-(furan-2-yl)-4,4,5,5-tetramethyl-1,2-thiazole? |
| A: Molecular formula of 3-(furan-2-yl)-4,4,5,5-tetramethyl-1,2-thiazole is C11H15NOS. |
| Q: What is the SMILES notation of 3-(furan-2-yl)-4,4,5,5-tetramethyl-1,2-thiazole? |
| A: SMILES notation of 3-(furan-2-yl)-4,4,5,5-tetramethyl-1,2-thiazole is CC1(C)SN=C(c2ccco2)C1(C)C. |
| Q: What is the polar surface area (PSA) of 3-(furan-2-yl)-4,4,5,5-tetramethyl-1,2-thiazole? |
| A: Polar surface area (PSA) of 3-(furan-2-yl)-4,4,5,5-tetramethyl-1,2-thiazole is 50.80000. |
| Q: What is the Chinese name of 89767-75-9? |
| A: Chinese name of 89767-75-9 is 89767-75-9. |