1-tert-butyl-3,5-di(propan-2-yl)benzene structure
|
Common Name | 1-tert-butyl-3,5-di(propan-2-yl)benzene | ||
|---|---|---|---|---|
| CAS Number | 89784-61-2 | Molecular Weight | 218.37800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H26 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-tert-butyl-3,5-di(propan-2-yl)benzene |
|---|
| Molecular Formula | C16H26 |
|---|---|
| Molecular Weight | 218.37800 |
| Exact Mass | 218.20300 |
| LogP | 5.23090 |
| InChIKey | WSEOMINRCROEKO-UHFFFAOYSA-N |
| SMILES | CC(C)c1cc(C(C)C)cc(C(C)(C)C)c1 |
|
~%
1-tert-butyl-3,... CAS#:89784-61-2 |
| Literature: Cheol, Hong Cheon; Yamamoto, Hisashi Journal of the American Chemical Society, 2008 , vol. 130, # 29 p. 9246 - 9247 |