N-[tert-butyl(ethyl)boranyl]-N-diethylboranyl-2-methylpropan-2-amine
![N-[tert-butyl(ethyl)boranyl]-N-diethylboranyl-2-methylpropan-2-amine Structure](https://image.chemsrc.com/caspic/281/89787-01-9.png)
N-[tert-butyl(ethyl)boranyl]-N-diethylboranyl-2-methylpropan-2-amine structure
|
Common Name | N-[tert-butyl(ethyl)boranyl]-N-diethylboranyl-2-methylpropan-2-amine | ||
|---|---|---|---|---|
| CAS Number | 89787-01-9 | Molecular Weight | 237.04100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H33B2N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[tert-butyl(ethyl)boranyl]-N-diethylboranyl-2-methylpropan-2-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H33B2N |
|---|---|
| Molecular Weight | 237.04100 |
| Exact Mass | 237.28000 |
| PSA | 3.24000 |
| LogP | 4.92970 |
| InChIKey | JHNGRXXELFUNOP-UHFFFAOYSA-N |
| SMILES | CCB(CC)N(B(CC)C(C)(C)C)C(C)(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~73%
N-[tert-butyl(e... CAS#:89787-01-9 |
| Literature: Paetzold, Peter; Plotho, Christoph von; Guenter, Schmid; Boese, Roland; Schrader, Bernhard; et al. Chemische Berichte, 1984 , vol. 117, p. 1089 - 1102 |
|
~%
N-[tert-butyl(e... CAS#:89787-01-9 |
| Literature: Paetzold, Peter; Plotho, Christoph von; Guenter, Schmid; Boese, Roland; Schrader, Bernhard; et al. Chemische Berichte, 1984 , vol. 117, p. 1089 - 1102 |
![2-Propanamine, N-[(1,1-dimethylethyl)borylene]-2-methyl structure](https://image.chemsrc.com/caspic/430/89786-99-2.png)
![N-[tert-butyl(chloro)boranyl]-2-methyl-N-trimethylsilylpropan-2-amine structure](https://image.chemsrc.com/caspic/468/89786-98-1.png)
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of N-[tert-butyl(ethyl)boranyl]-N-diethylboranyl-2-methylpropan-2-amine? |
| A: Molecular weight of N-[tert-butyl(ethyl)boranyl]-N-diethylboranyl-2-methylpropan-2-amine is 237.04100. |
| Q: What is the SMILES notation of N-[tert-butyl(ethyl)boranyl]-N-diethylboranyl-2-methylpropan-2-amine? |
| A: SMILES notation of N-[tert-butyl(ethyl)boranyl]-N-diethylboranyl-2-methylpropan-2-amine is CCB(CC)N(B(CC)C(C)(C)C)C(C)(C)C. |
| Q: What is the Chinese name of 89787-01-9? |
| A: Chinese name of 89787-01-9 is 89787-01-9. |
| Q: What is the English name of N-[tert-butyl(ethyl)boranyl]-N-diethylboranyl-2-methylpropan-2-amine? |
| A: The English name of N-[tert-butyl(ethyl)boranyl]-N-diethylboranyl-2-methylpropan-2-amine is N-[tert-butyl(ethyl)boranyl]-N-diethylboranyl-2-methylpropan-2-amine. |
| Q: What is the CAS number of N-[tert-butyl(ethyl)boranyl]-N-diethylboranyl-2-methylpropan-2-amine? |
| A: CAS number of N-[tert-butyl(ethyl)boranyl]-N-diethylboranyl-2-methylpropan-2-amine is 89787-01-9. |
| Q: What is the polar surface area (PSA) of N-[tert-butyl(ethyl)boranyl]-N-diethylboranyl-2-methylpropan-2-amine? |
| A: Polar surface area (PSA) of N-[tert-butyl(ethyl)boranyl]-N-diethylboranyl-2-methylpropan-2-amine is 3.24000. |
| Q: What is the molecular formula of N-[tert-butyl(ethyl)boranyl]-N-diethylboranyl-2-methylpropan-2-amine? |
| A: Molecular formula of N-[tert-butyl(ethyl)boranyl]-N-diethylboranyl-2-methylpropan-2-amine is C14H33B2N. |
| Q: What is the InChIKey of N-[tert-butyl(ethyl)boranyl]-N-diethylboranyl-2-methylpropan-2-amine? |
| A: InChIKey of N-[tert-butyl(ethyl)boranyl]-N-diethylboranyl-2-methylpropan-2-amine is JHNGRXXELFUNOP-UHFFFAOYSA-N. |
| Q: What is the LogP of N-[tert-butyl(ethyl)boranyl]-N-diethylboranyl-2-methylpropan-2-amine? |
| A: LogP of N-[tert-butyl(ethyl)boranyl]-N-diethylboranyl-2-methylpropan-2-amine is 4.92970. |