2-[4-(cyclohexylmethoxy)phenyl]acetamide structure
|
Common Name | 2-[4-(cyclohexylmethoxy)phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 89790-05-6 | Molecular Weight | 247.33300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[4-(cyclohexylmethoxy)phenyl]acetamide |
|---|
| Molecular Formula | C15H21NO2 |
|---|---|
| Molecular Weight | 247.33300 |
| Exact Mass | 247.15700 |
| PSA | 53.31000 |
| LogP | 3.82320 |
| InChIKey | YOUYGTFRWKIGMK-UHFFFAOYSA-N |
| SMILES | NC(=O)Cc1ccc(OCC2CCCCC2)cc1 |
|
~%
2-[4-(cyclohexy... CAS#:89790-05-6 |
| Literature: Freudenreich, Charles; Samama, Jean-Pierre; Biellmann, Jean-Francois Journal of the American Chemical Society, 1984 , vol. 106, # 11 p. 3344 - 3353 |
|
~%
2-[4-(cyclohexy... CAS#:89790-05-6 |
| Literature: Freudenreich, Charles; Samama, Jean-Pierre; Biellmann, Jean-Francois Journal of the American Chemical Society, 1984 , vol. 106, # 11 p. 3344 - 3353 |