8-[4-(2-amino-2-oxoethyl)phenoxy]octanoic acid
![8-[4-(2-amino-2-oxoethyl)phenoxy]octanoic acid Structure](https://image.chemsrc.com/caspic/377/89790-19-2.png)
8-[4-(2-amino-2-oxoethyl)phenoxy]octanoic acid structure
|
Common Name | 8-[4-(2-amino-2-oxoethyl)phenoxy]octanoic acid | ||
|---|---|---|---|---|
| CAS Number | 89790-19-2 | Molecular Weight | 293.35800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 8-[4-(2-amino-2-oxoethyl)phenoxy]octanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H23NO4 |
|---|---|
| Molecular Weight | 293.35800 |
| Exact Mass | 293.16300 |
| PSA | 90.61000 |
| LogP | 3.66810 |
| InChIKey | JMAKTTASHXONEZ-UHFFFAOYSA-N |
| SMILES | NC(=O)Cc1ccc(OCCCCCCCC(=O)O)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
8-[4-(2-amino-2... CAS#:89790-19-2 |
| Literature: Freudenreich, Charles; Samama, Jean-Pierre; Biellmann, Jean-Francois Journal of the American Chemical Society, 1984 , vol. 106, # 11 p. 3344 - 3353 |
|
~%
8-[4-(2-amino-2... CAS#:89790-19-2 |
| Literature: Freudenreich, Charles; Samama, Jean-Pierre; Biellmann, Jean-Francois Journal of the American Chemical Society, 1984 , vol. 106, # 11 p. 3344 - 3353 |
|
~%
8-[4-(2-amino-2... CAS#:89790-19-2 |
| Literature: Freudenreich, Charles; Samama, Jean-Pierre; Biellmann, Jean-Francois Journal of the American Chemical Society, 1984 , vol. 106, # 11 p. 3344 - 3353 |
|
~%
8-[4-(2-amino-2... CAS#:89790-19-2 |
| Literature: Freudenreich, Charles; Samama, Jean-Pierre; Biellmann, Jean-Francois Journal of the American Chemical Society, 1984 , vol. 106, # 11 p. 3344 - 3353 |
![methyl 8-[4-(2-amino-2-oxoethyl)phenoxy]octanoate structure](https://image.chemsrc.com/caspic/022/89790-20-5.png)
![methyl 8-[4-(cyanomethyl)phenoxy]octanoate structure](https://image.chemsrc.com/caspic/277/89790-31-8.png)
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 8-[4-(2-amino-2-oxoethyl)phenoxy]octanoic acid? |
| A: SMILES notation of 8-[4-(2-amino-2-oxoethyl)phenoxy]octanoic acid is NC(=O)Cc1ccc(OCCCCCCCC(=O)O)cc1. |
| Q: What is the English name of 8-[4-(2-amino-2-oxoethyl)phenoxy]octanoic acid? |
| A: The English name of 8-[4-(2-amino-2-oxoethyl)phenoxy]octanoic acid is 8-[4-(2-amino-2-oxoethyl)phenoxy]octanoic acid. |
| Q: What is the molecular weight of 8-[4-(2-amino-2-oxoethyl)phenoxy]octanoic acid? |
| A: Molecular weight of 8-[4-(2-amino-2-oxoethyl)phenoxy]octanoic acid is 293.35800. |
| Q: What is the InChIKey of 8-[4-(2-amino-2-oxoethyl)phenoxy]octanoic acid? |
| A: InChIKey of 8-[4-(2-amino-2-oxoethyl)phenoxy]octanoic acid is JMAKTTASHXONEZ-UHFFFAOYSA-N. |
| Q: What is the LogP of 8-[4-(2-amino-2-oxoethyl)phenoxy]octanoic acid? |
| A: LogP of 8-[4-(2-amino-2-oxoethyl)phenoxy]octanoic acid is 3.66810. |
| Q: What is the molecular formula of 8-[4-(2-amino-2-oxoethyl)phenoxy]octanoic acid? |
| A: Molecular formula of 8-[4-(2-amino-2-oxoethyl)phenoxy]octanoic acid is C16H23NO4. |
| Q: What is the Chinese name of 89790-19-2? |
| A: Chinese name of 89790-19-2 is 89790-19-2. |
| Q: What is the polar surface area (PSA) of 8-[4-(2-amino-2-oxoethyl)phenoxy]octanoic acid? |
| A: Polar surface area (PSA) of 8-[4-(2-amino-2-oxoethyl)phenoxy]octanoic acid is 90.61000. |
| Q: What is the CAS number of 8-[4-(2-amino-2-oxoethyl)phenoxy]octanoic acid? |
| A: CAS number of 8-[4-(2-amino-2-oxoethyl)phenoxy]octanoic acid is 89790-19-2. |