2-Amino-3-nitro-4,6-dimethyl-5-bromopyridine structure
|
Common Name | 2-Amino-3-nitro-4,6-dimethyl-5-bromopyridine | ||
|---|---|---|---|---|
| CAS Number | 89791-76-4 | Molecular Weight | 246.06100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H8BrN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-bromo-4,6-dimethyl-3-nitropyridin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H8BrN3O2 |
|---|---|
| Molecular Weight | 246.06100 |
| Exact Mass | 244.98000 |
| PSA | 84.73000 |
| LogP | 3.05570 |
| InChIKey | AWUOLSBKAQIADQ-UHFFFAOYSA-N |
| SMILES | Cc1nc(N)c([N+](=O)[O-])c(C)c1Br |
| HS Code | 2933399090 |
|---|
|
~94%
2-Amino-3-nitro... CAS#:89791-76-4 |
| Literature: Heitsch, Holger; Becker, Reinhard H.A.; Kleemann, Heinz-Werner; Wagner, Adalbert Bioorganic and Medicinal Chemistry, 1997 , vol. 5, # 4 p. 673 - 678 |
|
~%
2-Amino-3-nitro... CAS#:89791-76-4 |
| Literature: Tanga; Bradford; Bupp; Kozocas Journal of Heterocyclic Chemistry, 2003 , vol. 40, # 4 p. 569 - 573 |
| Precursor 2 | |
|---|---|
| DownStream 7 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Pyridinamine,5-bromo-4,6-dimethyl-3-nitro |
| 2-amino-5-bromo-4,6-dimethyl-3-nitropyridine |
| 5-bromo-4,6-dimethyl-3-nitro-2-pyridinylamine |
| 6-amino-3-bromo-5-nitro-2,4-lutidine |
| 5-bromo-4,6-dimethyl-3-nitro-pyridin-2-ylamine |
| 2-amino-3-nitro-4,6-dimethyl-5-bromo-pyridine |
| 5-bromo-4,6-dimethyl-3-nitro-[2]pyridylamine |
| 5-Brom-4,6-dimethyl-3-nitro-[2]pyridylamin |