1-(4-Bromophenyl)-1,1-difluoropropan-2-one
Modify Date: 2026-08-05 12:48:27
1-(4-Bromophenyl)-1,1-difluoropropan-2-one structure
|
Common Name | 1-(4-Bromophenyl)-1,1-difluoropropan-2-one | ||
|---|---|---|---|---|
| CAS Number | 897934-99-5 | Molecular Weight | 249.05 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7BrF2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(4-Bromophenyl)-1,1-difluoropropan-2-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H7BrF2O |
|---|---|
| Molecular Weight | 249.05 |
| InChIKey | PGARJEGPWFGHKP-UHFFFAOYSA-N |
| SMILES | CC(=O)C(F)(F)c1ccc(Br)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-(4-Bromophenyl)-1,1-difluoropropan-2-one? |
| A: InChIKey of 1-(4-Bromophenyl)-1,1-difluoropropan-2-one is PGARJEGPWFGHKP-UHFFFAOYSA-N. |
| Q: What is the English name of 1-(4-Bromophenyl)-1,1-difluoropropan-2-one? |
| A: The English name of 1-(4-Bromophenyl)-1,1-difluoropropan-2-one is 1-(4-Bromophenyl)-1,1-difluoropropan-2-one. |
| Q: What is the CAS number of 1-(4-Bromophenyl)-1,1-difluoropropan-2-one? |
| A: CAS number of 1-(4-Bromophenyl)-1,1-difluoropropan-2-one is 897934-99-5. |
| Q: What is the molecular weight of 1-(4-Bromophenyl)-1,1-difluoropropan-2-one? |
| A: Molecular weight of 1-(4-Bromophenyl)-1,1-difluoropropan-2-one is 249.05. |
| Q: What is the molecular formula of 1-(4-Bromophenyl)-1,1-difluoropropan-2-one? |
| A: Molecular formula of 1-(4-Bromophenyl)-1,1-difluoropropan-2-one is C9H7BrF2O. |
| Q: What is the Chinese name of 897934-99-5? |
| A: Chinese name of 897934-99-5 is 897934-99-5. |
| Q: What is the SMILES notation of 1-(4-Bromophenyl)-1,1-difluoropropan-2-one? |
| A: SMILES notation of 1-(4-Bromophenyl)-1,1-difluoropropan-2-one is CC(=O)C(F)(F)c1ccc(Br)cc1. |