1-(5-methylsulfanyl-2-pyridin-4-yl-2H-1,3,4-thiadiazol-3-yl)ethanone structure
|
Common Name | 1-(5-methylsulfanyl-2-pyridin-4-yl-2H-1,3,4-thiadiazol-3-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 89806-03-1 | Molecular Weight | 253.34400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11N3OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(5-methylsulfanyl-2-pyridin-4-yl-2H-1,3,4-thiadiazol-3-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H11N3OS2 |
|---|---|
| Molecular Weight | 253.34400 |
| Exact Mass | 253.03400 |
| PSA | 96.16000 |
| LogP | 1.68300 |
| InChIKey | BMIOTLLSRPQBON-UHFFFAOYSA-N |
| SMILES | CSC1=NN(C(C)=O)C(c2ccncc2)S1 |
|
~79%
1-(5-methylsulf... CAS#:89806-03-1 |
| Literature: Kubota, Seiju; Toyooka, Kouhei; Misra, Hemant K.; Kawano, Michinobu; Shibuya, Masayuki Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 12 p. 2957 - 2962 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 4-acetyl-2-methylthio-5-(4-pyridyl)-4,5-dihydro-1,3,4-thiadiazole |