methyl N-(quinolin-4-ylmethylideneamino)carbamodithioate structure
|
Common Name | methyl N-(quinolin-4-ylmethylideneamino)carbamodithioate | ||
|---|---|---|---|---|
| CAS Number | 89806-08-6 | Molecular Weight | 261.36600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11N3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl N-(quinolin-4-ylmethylideneamino)carbamodithioate |
|---|
| Molecular Formula | C12H11N3S2 |
|---|---|
| Molecular Weight | 261.36600 |
| Exact Mass | 261.03900 |
| PSA | 101.71000 |
| LogP | 3.21750 |
| InChIKey | YOQVWPCEMZPZJN-UHFFFAOYSA-N |
| SMILES | CSC(=S)NN=Cc1ccnc2ccccc12 |
|
~76%
methyl N-(quino... CAS#:89806-08-6 |
| Literature: Kubota, Seiju; Toyooka, Kouhei; Misra, Hemant K.; Kawano, Michinobu; Shibuya, Masayuki Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 12 p. 2957 - 2962 |