2-amino-6-phenyl-4-propan-2-yl-4H-pyran-3,5-dicarbonitrile
2-amino-6-phenyl-4-propan-2-yl-4H-pyran-3,5-dicarbonitrile structure
|
Common Name | 2-amino-6-phenyl-4-propan-2-yl-4H-pyran-3,5-dicarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 89809-86-9 | Molecular Weight | 265.31000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-amino-6-phenyl-4-propan-2-yl-4H-pyran-3,5-dicarbonitrile |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H15N3O |
|---|---|
| Molecular Weight | 265.31000 |
| Exact Mass | 265.12200 |
| PSA | 82.83000 |
| LogP | 3.61786 |
| InChIKey | FLCKJKQIPYNBJS-UHFFFAOYSA-N |
| SMILES | CC(C)C1C(C#N)=C(N)OC(c2ccccc2)=C1C#N |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~59%
2-amino-6-pheny... CAS#:89809-86-9 |
| Literature: Soto, Jose L.; Seoane, Carlos; Martin, Nazario; Quinteiro, Margarita Heterocycles, 1984 , vol. 22, # 1 p. 1 - 6 |
|
~%
2-amino-6-pheny... CAS#:89809-86-9 |
| Literature: Soto, Jose L.; Seoane, Carlos; Martin, Nazario; Quinteiro, Margarita Heterocycles, 1984 , vol. 22, # 1 p. 1 - 6 |
|
~%
2-amino-6-pheny... CAS#:89809-86-9 |
| Literature: Ciller, Juan A.; Martin, Nazario; Seoane, Carlos; Soto, Jose L. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1985 , p. 2581 - 2584 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-amino-3,5-dicyano-4-isopropyl-6-phenyl-4H-pyran |
| 3,5-dicyano-4-isopropyl-6-phenyl-4H-pyran-2-amine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 2-amino-6-phenyl-4-propan-2-yl-4H-pyran-3,5-dicarbonitrile have? |
| A: English synonyms of 2-amino-6-phenyl-4-propan-2-yl-4H-pyran-3,5-dicarbonitrile: 2-amino-3,5-dicyano-4-isopropyl-6-phenyl-4H-pyran, 3,5-dicyano-4-isopropyl-6-phenyl-4H-pyran-2-amine. |
| Q: What is the Chinese name of 89809-86-9? |
| A: Chinese name of 89809-86-9 is 89809-86-9. |
| Q: What is the InChIKey of 2-amino-6-phenyl-4-propan-2-yl-4H-pyran-3,5-dicarbonitrile? |
| A: InChIKey of 2-amino-6-phenyl-4-propan-2-yl-4H-pyran-3,5-dicarbonitrile is FLCKJKQIPYNBJS-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-amino-6-phenyl-4-propan-2-yl-4H-pyran-3,5-dicarbonitrile? |
| A: CAS number of 2-amino-6-phenyl-4-propan-2-yl-4H-pyran-3,5-dicarbonitrile is 89809-86-9. |
| Q: What is the polar surface area (PSA) of 2-amino-6-phenyl-4-propan-2-yl-4H-pyran-3,5-dicarbonitrile? |
| A: Polar surface area (PSA) of 2-amino-6-phenyl-4-propan-2-yl-4H-pyran-3,5-dicarbonitrile is 82.83000. |
| Q: What is the English name of 2-amino-6-phenyl-4-propan-2-yl-4H-pyran-3,5-dicarbonitrile? |
| A: The English name of 2-amino-6-phenyl-4-propan-2-yl-4H-pyran-3,5-dicarbonitrile is 2-amino-6-phenyl-4-propan-2-yl-4H-pyran-3,5-dicarbonitrile. |
| Q: What is the LogP of 2-amino-6-phenyl-4-propan-2-yl-4H-pyran-3,5-dicarbonitrile? |
| A: LogP of 2-amino-6-phenyl-4-propan-2-yl-4H-pyran-3,5-dicarbonitrile is 3.61786. |
| Q: What is the SMILES notation of 2-amino-6-phenyl-4-propan-2-yl-4H-pyran-3,5-dicarbonitrile? |
| A: SMILES notation of 2-amino-6-phenyl-4-propan-2-yl-4H-pyran-3,5-dicarbonitrile is CC(C)C1C(C#N)=C(N)OC(c2ccccc2)=C1C#N. |
| Q: What is the molecular weight of 2-amino-6-phenyl-4-propan-2-yl-4H-pyran-3,5-dicarbonitrile? |
| A: Molecular weight of 2-amino-6-phenyl-4-propan-2-yl-4H-pyran-3,5-dicarbonitrile is 265.31000. |
| Q: What is the molecular formula of 2-amino-6-phenyl-4-propan-2-yl-4H-pyran-3,5-dicarbonitrile? |
| A: Molecular formula of 2-amino-6-phenyl-4-propan-2-yl-4H-pyran-3,5-dicarbonitrile is C16H15N3O. |