4-amino-2-phenyl-3-oxaspiro[5.5]undeca-1,4-diene-1,5-dicarbonitrile
![4-amino-2-phenyl-3-oxaspiro[5.5]undeca-1,4-diene-1,5-dicarbonitrile Structure](https://image.chemsrc.com/caspic/440/89809-97-2.png)
4-amino-2-phenyl-3-oxaspiro[5.5]undeca-1,4-diene-1,5-dicarbonitrile structure
|
Common Name | 4-amino-2-phenyl-3-oxaspiro[5.5]undeca-1,4-diene-1,5-dicarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 89809-97-2 | Molecular Weight | 291.34700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H17N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-amino-2-phenyl-3-oxaspiro[5.5]undeca-1,4-diene-1,5-dicarbonitrile |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H17N3O |
|---|---|
| Molecular Weight | 291.34700 |
| Exact Mass | 291.13700 |
| PSA | 82.83000 |
| LogP | 4.29616 |
| InChIKey | RRSLIKVBQLYIFA-UHFFFAOYSA-N |
| SMILES | N#CC1=C(N)OC(c2ccccc2)=C(C#N)C12CCCCC2 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~50%
4-amino-2-pheny... CAS#:89809-97-2 |
| Literature: Soto, Jose L.; Seoane, Carlos; Martin, Nazario; Quinteiro, Margarita Heterocycles, 1984 , vol. 22, # 1 p. 1 - 6 |
|
~%
4-amino-2-pheny... CAS#:89809-97-2 |
| Literature: Soto, Jose L.; Seoane, Carlos; Martin, Nazario; Quinteiro, Margarita Heterocycles, 1984 , vol. 22, # 1 p. 1 - 6 |
|
~%
4-amino-2-pheny... CAS#:89809-97-2 |
| Literature: Soto, Jose L.; Seoane, Carlos; Martin, Nazario; Quinteiro, Margarita Heterocycles, 1984 , vol. 22, # 1 p. 1 - 6 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-amino-3,5-dicyano-6-phenyl-4H-pyran-4-spirocyclohexane |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 4-amino-2-phenyl-3-oxaspiro[5.5]undeca-1,4-diene-1,5-dicarbonitrile have? |
| A: English synonyms of 4-amino-2-phenyl-3-oxaspiro[5.5]undeca-1,4-diene-1,5-dicarbonitrile: 2-amino-3,5-dicyano-6-phenyl-4H-pyran-4-spirocyclohexane. |
| Q: What is the polar surface area (PSA) of 4-amino-2-phenyl-3-oxaspiro[5.5]undeca-1,4-diene-1,5-dicarbonitrile? |
| A: Polar surface area (PSA) of 4-amino-2-phenyl-3-oxaspiro[5.5]undeca-1,4-diene-1,5-dicarbonitrile is 82.83000. |
| Q: What is the CAS number of 4-amino-2-phenyl-3-oxaspiro[5.5]undeca-1,4-diene-1,5-dicarbonitrile? |
| A: CAS number of 4-amino-2-phenyl-3-oxaspiro[5.5]undeca-1,4-diene-1,5-dicarbonitrile is 89809-97-2. |
| Q: What is the SMILES notation of 4-amino-2-phenyl-3-oxaspiro[5.5]undeca-1,4-diene-1,5-dicarbonitrile? |
| A: SMILES notation of 4-amino-2-phenyl-3-oxaspiro[5.5]undeca-1,4-diene-1,5-dicarbonitrile is N#CC1=C(N)OC(c2ccccc2)=C(C#N)C12CCCCC2. |
| Q: What is the molecular formula of 4-amino-2-phenyl-3-oxaspiro[5.5]undeca-1,4-diene-1,5-dicarbonitrile? |
| A: Molecular formula of 4-amino-2-phenyl-3-oxaspiro[5.5]undeca-1,4-diene-1,5-dicarbonitrile is C18H17N3O. |
| Q: What is the Chinese name of 89809-97-2? |
| A: Chinese name of 89809-97-2 is 89809-97-2. |
| Q: What is the English name of 4-amino-2-phenyl-3-oxaspiro[5.5]undeca-1,4-diene-1,5-dicarbonitrile? |
| A: The English name of 4-amino-2-phenyl-3-oxaspiro[5.5]undeca-1,4-diene-1,5-dicarbonitrile is 4-amino-2-phenyl-3-oxaspiro[5.5]undeca-1,4-diene-1,5-dicarbonitrile. |
| Q: What is the InChIKey of 4-amino-2-phenyl-3-oxaspiro[5.5]undeca-1,4-diene-1,5-dicarbonitrile? |
| A: InChIKey of 4-amino-2-phenyl-3-oxaspiro[5.5]undeca-1,4-diene-1,5-dicarbonitrile is RRSLIKVBQLYIFA-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-amino-2-phenyl-3-oxaspiro[5.5]undeca-1,4-diene-1,5-dicarbonitrile? |
| A: Molecular weight of 4-amino-2-phenyl-3-oxaspiro[5.5]undeca-1,4-diene-1,5-dicarbonitrile is 291.34700. |
| Q: What is the LogP of 4-amino-2-phenyl-3-oxaspiro[5.5]undeca-1,4-diene-1,5-dicarbonitrile? |
| A: LogP of 4-amino-2-phenyl-3-oxaspiro[5.5]undeca-1,4-diene-1,5-dicarbonitrile is 4.29616. |