N-benzyl-3-(5-nitrofuran-2-yl)prop-2-enamide structure
|
Common Name | N-benzyl-3-(5-nitrofuran-2-yl)prop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 89811-27-8 | Molecular Weight | 272.25600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-benzyl-3-(5-nitrofuran-2-yl)prop-2-enamide |
|---|
| Molecular Formula | C14H12N2O4 |
|---|---|
| Molecular Weight | 272.25600 |
| Exact Mass | 272.08000 |
| PSA | 91.55000 |
| LogP | 3.88090 |
| InChIKey | WLGOLTAXKGWYJV-UHFFFAOYSA-N |
| SMILES | O=C(C=Cc1ccc([N+](=O)[O-])o1)NCc1ccccc1 |
|
~89%
N-benzyl-3-(5-n... CAS#:89811-27-8 |
| Literature: Pozas, Rocio; Carballo, Javier; Castro, Clementina; Rubio, Julieta Bioorganic and Medicinal Chemistry Letters, 2005 , vol. 15, # 5 p. 1417 - 1421 |
|
~%
N-benzyl-3-(5-n... CAS#:89811-27-8 |
| Literature: Pozas, Rocio; Carballo, Javier; Castro, Clementina; Rubio, Julieta Bioorganic and Medicinal Chemistry Letters, 2005 , vol. 15, # 5 p. 1417 - 1421 |
|
~%
N-benzyl-3-(5-n... CAS#:89811-27-8 |
| Literature: Pozas, Rocio; Carballo, Javier; Castro, Clementina; Rubio, Julieta Bioorganic and Medicinal Chemistry Letters, 2005 , vol. 15, # 5 p. 1417 - 1421 |