2-(3,4-dihydroxy-4-methylcyclohexyl)prop-2-enyl acetate structure
|
Common Name | 2-(3,4-dihydroxy-4-methylcyclohexyl)prop-2-enyl acetate | ||
|---|---|---|---|---|
| CAS Number | 89822-05-9 | Molecular Weight | 228.28500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3,4-dihydroxy-4-methylcyclohexyl)prop-2-enyl acetate |
|---|
| Molecular Formula | C12H20O4 |
|---|---|
| Molecular Weight | 228.28500 |
| Exact Mass | 228.13600 |
| PSA | 66.76000 |
| LogP | 1.01770 |
| InChIKey | NMFUQRSKVCEUQJ-UHFFFAOYSA-N |
| SMILES | C=C(COC(C)=O)C1CCC(C)(O)C(O)C1 |
|
~%
2-(3,4-dihydrox... CAS#:89822-05-9 |
| Literature: Suemune; Kawahara; Sakai Chemical and Pharmaceutical Bulletin, 1986 , vol. 34, # 2 p. 550 - 557 |
|
~%
2-(3,4-dihydrox... CAS#:89822-05-9 |
| Literature: Suemune; Kawahara; Sakai Chemical and Pharmaceutical Bulletin, 1986 , vol. 34, # 2 p. 550 - 557 |
|
~%
2-(3,4-dihydrox... CAS#:89822-05-9 |
| Literature: Suemune; Kawahara; Sakai Chemical and Pharmaceutical Bulletin, 1986 , vol. 34, # 2 p. 550 - 557 |