1-[1-methyl-6-(3-methylbut-2-enyl)cyclohex-2-en-1-yl]pent-1-en-3-ol structure
|
Common Name | 1-[1-methyl-6-(3-methylbut-2-enyl)cyclohex-2-en-1-yl]pent-1-en-3-ol | ||
|---|---|---|---|---|
| CAS Number | 89827-66-7 | Molecular Weight | 248.40400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H28O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[1-methyl-6-(3-methylbut-2-enyl)cyclohex-2-en-1-yl]pent-1-en-3-ol |
|---|
| Molecular Formula | C17H28O |
|---|---|
| Molecular Weight | 248.40400 |
| Exact Mass | 248.21400 |
| PSA | 20.23000 |
| LogP | 4.64230 |
| InChIKey | LMAHLHQNMDVOLH-UHFFFAOYSA-N |
| SMILES | CCC(O)C=CC1(C)C=CCCC1CC=C(C)C |
|
~%
1-[1-methyl-6-(... CAS#:89827-66-7 |
| Literature: Batt; Takamura; Ganem Journal of the American Chemical Society, 1984 , vol. 106, # 11 p. 3353 - 3354 |
|
~%
1-[1-methyl-6-(... CAS#:89827-66-7 |
| Literature: Batt; Takamura; Ganem Journal of the American Chemical Society, 1984 , vol. 106, # 11 p. 3353 - 3354 |