N1-(2,4-difluorophenyl)-N2-(2-methylbenzyl)oxalamide
Modify Date: 2026-06-25 17:50:04
N1-(2,4-difluorophenyl)-N2-(2-methylbenzyl)oxalamide structure
|
Common Name | N1-(2,4-difluorophenyl)-N2-(2-methylbenzyl)oxalamide | ||
|---|---|---|---|---|
| CAS Number | 898357-16-9 | Molecular Weight | 304.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14F2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N1-(2,4-difluorophenyl)-N2-(2-methylbenzyl)oxalamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H14F2N2O2 |
|---|---|
| Molecular Weight | 304.29 |
| InChIKey | HXAYTDLBZGPBTB-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1CNC(=O)C(=O)NC2=C(C=C(C=C2)F)F |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 898357-16-9? |
| A: Chinese name of 898357-16-9 is 898357-16-9. |
| Q: What is the SMILES notation of N1-(2,4-difluorophenyl)-N2-(2-methylbenzyl)oxalamide? |
| A: SMILES notation of N1-(2,4-difluorophenyl)-N2-(2-methylbenzyl)oxalamide is CC1=CC=CC=C1CNC(=O)C(=O)NC2=C(C=C(C=C2)F)F. |
| Q: What is the InChIKey of N1-(2,4-difluorophenyl)-N2-(2-methylbenzyl)oxalamide? |
| A: InChIKey of N1-(2,4-difluorophenyl)-N2-(2-methylbenzyl)oxalamide is HXAYTDLBZGPBTB-UHFFFAOYSA-N. |
| Q: What is the molecular weight of N1-(2,4-difluorophenyl)-N2-(2-methylbenzyl)oxalamide? |
| A: Molecular weight of N1-(2,4-difluorophenyl)-N2-(2-methylbenzyl)oxalamide is 304.29. |
| Q: What is the English name of N1-(2,4-difluorophenyl)-N2-(2-methylbenzyl)oxalamide? |
| A: The English name of N1-(2,4-difluorophenyl)-N2-(2-methylbenzyl)oxalamide is N1-(2,4-difluorophenyl)-N2-(2-methylbenzyl)oxalamide. |
| Q: What is the molecular formula of N1-(2,4-difluorophenyl)-N2-(2-methylbenzyl)oxalamide? |
| A: Molecular formula of N1-(2,4-difluorophenyl)-N2-(2-methylbenzyl)oxalamide is C16H14F2N2O2. |
| Q: What is the CAS number of N1-(2,4-difluorophenyl)-N2-(2-methylbenzyl)oxalamide? |
| A: CAS number of N1-(2,4-difluorophenyl)-N2-(2-methylbenzyl)oxalamide is 898357-16-9. |