2-Ethyl-5-((4-nitrophenyl)(piperidin-1-yl)methyl)thiazolo[3,2-b][1,2,4]triazol-6-ol
Modify Date: 2025-09-24 16:04:50
![2-Ethyl-5-((4-nitrophenyl)(piperidin-1-yl)methyl)thiazolo[3,2-b][1,2,4]triazol-6-ol Structure](https://www.chemsrc.com/extcaspic/274/898361-49-4.png)
2-Ethyl-5-((4-nitrophenyl)(piperidin-1-yl)methyl)thiazolo[3,2-b][1,2,4]triazol-6-ol structure
|
Common Name | 2-Ethyl-5-((4-nitrophenyl)(piperidin-1-yl)methyl)thiazolo[3,2-b][1,2,4]triazol-6-ol | ||
|---|---|---|---|---|
| CAS Number | 898361-49-4 | Molecular Weight | 387.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H21N5O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Ethyl-5-((4-nitrophenyl)(piperidin-1-yl)methyl)thiazolo[3,2-b][1,2,4]triazol-6-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H21N5O3S |
|---|---|
| Molecular Weight | 387.5 |
| InChIKey | WDEFPGFWTHSFHE-UHFFFAOYSA-N |
| SMILES | CCc1nc2sc(C(c3ccc([N+](=O)[O-])cc3)N3CCCCC3)c(O)n2n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-Ethyl-5-((4-nitrophenyl)(piperidin-1-yl)methyl)thiazolo[3,2-b][1,2,4]triazol-6-ol? |
| A: InChIKey of 2-Ethyl-5-((4-nitrophenyl)(piperidin-1-yl)methyl)thiazolo[3,2-b][1,2,4]triazol-6-ol is WDEFPGFWTHSFHE-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-Ethyl-5-((4-nitrophenyl)(piperidin-1-yl)methyl)thiazolo[3,2-b][1,2,4]triazol-6-ol? |
| A: Molecular weight of 2-Ethyl-5-((4-nitrophenyl)(piperidin-1-yl)methyl)thiazolo[3,2-b][1,2,4]triazol-6-ol is 387.5. |
| Q: What is the English name of 2-Ethyl-5-((4-nitrophenyl)(piperidin-1-yl)methyl)thiazolo[3,2-b][1,2,4]triazol-6-ol? |
| A: The English name of 2-Ethyl-5-((4-nitrophenyl)(piperidin-1-yl)methyl)thiazolo[3,2-b][1,2,4]triazol-6-ol is 2-Ethyl-5-((4-nitrophenyl)(piperidin-1-yl)methyl)thiazolo[3,2-b][1,2,4]triazol-6-ol. |
| Q: What is the molecular formula of 2-Ethyl-5-((4-nitrophenyl)(piperidin-1-yl)methyl)thiazolo[3,2-b][1,2,4]triazol-6-ol? |
| A: Molecular formula of 2-Ethyl-5-((4-nitrophenyl)(piperidin-1-yl)methyl)thiazolo[3,2-b][1,2,4]triazol-6-ol is C18H21N5O3S. |
| Q: What is the SMILES notation of 2-Ethyl-5-((4-nitrophenyl)(piperidin-1-yl)methyl)thiazolo[3,2-b][1,2,4]triazol-6-ol? |
| A: SMILES notation of 2-Ethyl-5-((4-nitrophenyl)(piperidin-1-yl)methyl)thiazolo[3,2-b][1,2,4]triazol-6-ol is CCc1nc2sc(C(c3ccc([N+](=O)[O-])cc3)N3CCCCC3)c(O)n2n1. |
| Q: What is the CAS number of 2-Ethyl-5-((4-nitrophenyl)(piperidin-1-yl)methyl)thiazolo[3,2-b][1,2,4]triazol-6-ol? |
| A: CAS number of 2-Ethyl-5-((4-nitrophenyl)(piperidin-1-yl)methyl)thiazolo[3,2-b][1,2,4]triazol-6-ol is 898361-49-4. |
| Q: What is the Chinese name of 898361-49-4? |
| A: Chinese name of 898361-49-4 is 898361-49-4. |