Octimibate structure
|
Common Name | Octimibate | ||
|---|---|---|---|---|
| CAS Number | 89838-96-0 | Molecular Weight | 454.56000 | |
| Density | 1.13g/cm3 | Boiling Point | 642.4ºC at 760 mmHg | |
| Molecular Formula | C29H30N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 342.3ºC | |
| Name | 8-(1,4,5-triphenylimidazol-2-yl)oxyoctanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 642.4ºC at 760 mmHg |
| Molecular Formula | C29H30N2O3 |
| Molecular Weight | 454.56000 |
| Flash Point | 342.3ºC |
| Exact Mass | 454.22600 |
| PSA | 64.35000 |
| LogP | 7.01030 |
| Index of Refraction | 1.593 |
| InChIKey | JJNUVQIGQRFZAC-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCCCCOc1nc(-c2ccccc2)c(-c2ccccc2)n1-c1ccccc1 |
| HS Code | 2933290090 |
|---|
|
~%
Octimibate CAS#:89838-96-0 |
| Literature: A. Nattermann and Cie GMBH Patent: US4460598 A1, 1984 ; |
|
~%
Octimibate CAS#:89838-96-0 |
| Literature: SmithKline Beecham Corporation; The Johns Hopkins University Patent: US5648373 A1, 1997 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| UNII-S0SIQ441YZ |
| Octimibato |
| Octimibate |
| Octimibatum |