2-(2-diphenylphosphorylpropyl)-2-phenyl-1,3-dioxolane structure
|
Common Name | 2-(2-diphenylphosphorylpropyl)-2-phenyl-1,3-dioxolane | ||
|---|---|---|---|---|
| CAS Number | 89839-61-2 | Molecular Weight | 392.42700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H25O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-diphenylphosphorylpropyl)-2-phenyl-1,3-dioxolane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H25O3P |
|---|---|
| Molecular Weight | 392.42700 |
| Exact Mass | 392.15400 |
| PSA | 45.34000 |
| LogP | 4.67890 |
| InChIKey | OPYRLNFPQLIWPY-UHFFFAOYSA-N |
| SMILES | CC(CC1(c2ccccc2)OCCO1)P(=O)(c1ccccc1)c1ccccc1 |
|
~91%
2-(2-diphenylph... CAS#:89839-61-2 |
| Literature: Earnshaw, Chris; Torr, Richard S.; Warren, Stuart Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 12 p. 2893 - 2902 |
| 3-diphenylphosphinoyl-1-phenylbutan-1-one ethylene acetal |