Benzenesulfonamide,4-nitro-N,N-dipropyl- structure
|
Common Name | Benzenesulfonamide,4-nitro-N,N-dipropyl- | ||
|---|---|---|---|---|
| CAS Number | 89840-83-5 | Molecular Weight | 286.34700 | |
| Density | 1.229g/cm3 | Boiling Point | 416.7ºC at 760mmHg | |
| Molecular Formula | C12H18N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.8ºC | |
| Name | 4-nitro-N,N-dipropylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.229g/cm3 |
|---|---|
| Boiling Point | 416.7ºC at 760mmHg |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.34700 |
| Flash Point | 205.8ºC |
| Exact Mass | 286.09900 |
| PSA | 91.58000 |
| LogP | 4.00950 |
| Index of Refraction | 1.541 |
| InChIKey | FHJOMNWSFGPGKH-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
|
~%
Benzenesulfonam... CAS#:89840-83-5 |
| Literature: Campbell; Campbell; Salm Proceedings of the Indiana Academy of Science, 1948 , vol. 57, p. 100 Chem.Abstr., 1949 , p. 4630 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-nitro-benzenesulfonic acid dipropylamide |
| 4-Nitro-benzolsulfonsaeure-dipropylamid |