N1-(2,5-difluorophenyl)-N2-(2-(indolin-1-yl)-2-(thiophen-2-yl)ethyl)oxalamide
Modify Date: 2026-08-02 18:29:12
N1-(2,5-difluorophenyl)-N2-(2-(indolin-1-yl)-2-(thiophen-2-yl)ethyl)oxalamide structure
|
Common Name | N1-(2,5-difluorophenyl)-N2-(2-(indolin-1-yl)-2-(thiophen-2-yl)ethyl)oxalamide | ||
|---|---|---|---|---|
| CAS Number | 898407-73-3 | Molecular Weight | 427.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H19F2N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N1-(2,5-difluorophenyl)-N2-(2-(indolin-1-yl)-2-(thiophen-2-yl)ethyl)oxalamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H19F2N3O2S |
|---|---|
| Molecular Weight | 427.5 |
| InChIKey | VMRLRTYDOHSVBH-UHFFFAOYSA-N |
| SMILES | O=C(NCC(c1cccs1)N1CCc2ccccc21)C(=O)Nc1cc(F)ccc1F |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of N1-(2,5-difluorophenyl)-N2-(2-(indolin-1-yl)-2-(thiophen-2-yl)ethyl)oxalamide? |
| A: Molecular weight of N1-(2,5-difluorophenyl)-N2-(2-(indolin-1-yl)-2-(thiophen-2-yl)ethyl)oxalamide is 427.5. |
| Q: What is the SMILES notation of N1-(2,5-difluorophenyl)-N2-(2-(indolin-1-yl)-2-(thiophen-2-yl)ethyl)oxalamide? |
| A: SMILES notation of N1-(2,5-difluorophenyl)-N2-(2-(indolin-1-yl)-2-(thiophen-2-yl)ethyl)oxalamide is O=C(NCC(c1cccs1)N1CCc2ccccc21)C(=O)Nc1cc(F)ccc1F. |
| Q: What is the CAS number of N1-(2,5-difluorophenyl)-N2-(2-(indolin-1-yl)-2-(thiophen-2-yl)ethyl)oxalamide? |
| A: CAS number of N1-(2,5-difluorophenyl)-N2-(2-(indolin-1-yl)-2-(thiophen-2-yl)ethyl)oxalamide is 898407-73-3. |
| Q: What is the Chinese name of 898407-73-3? |
| A: Chinese name of 898407-73-3 is 898407-73-3. |
| Q: What is the English name of N1-(2,5-difluorophenyl)-N2-(2-(indolin-1-yl)-2-(thiophen-2-yl)ethyl)oxalamide? |
| A: The English name of N1-(2,5-difluorophenyl)-N2-(2-(indolin-1-yl)-2-(thiophen-2-yl)ethyl)oxalamide is N1-(2,5-difluorophenyl)-N2-(2-(indolin-1-yl)-2-(thiophen-2-yl)ethyl)oxalamide. |
| Q: What is the InChIKey of N1-(2,5-difluorophenyl)-N2-(2-(indolin-1-yl)-2-(thiophen-2-yl)ethyl)oxalamide? |
| A: InChIKey of N1-(2,5-difluorophenyl)-N2-(2-(indolin-1-yl)-2-(thiophen-2-yl)ethyl)oxalamide is VMRLRTYDOHSVBH-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N1-(2,5-difluorophenyl)-N2-(2-(indolin-1-yl)-2-(thiophen-2-yl)ethyl)oxalamide? |
| A: Molecular formula of N1-(2,5-difluorophenyl)-N2-(2-(indolin-1-yl)-2-(thiophen-2-yl)ethyl)oxalamide is C22H19F2N3O2S. |