7-butyl-8-(4-(3-chlorobenzyl)piperazin-1-yl)-3-methyl-1H-purine-2,6(3H,7H)-dione
Modify Date: 2026-07-05 09:00:41
7-butyl-8-(4-(3-chlorobenzyl)piperazin-1-yl)-3-methyl-1H-purine-2,6(3H,7H)-dione structure
|
Common Name | 7-butyl-8-(4-(3-chlorobenzyl)piperazin-1-yl)-3-methyl-1H-purine-2,6(3H,7H)-dione | ||
|---|---|---|---|---|
| CAS Number | 898437-27-9 | Molecular Weight | 430.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H27ClN6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-butyl-8-(4-(3-chlorobenzyl)piperazin-1-yl)-3-methyl-1H-purine-2,6(3H,7H)-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H27ClN6O2 |
|---|---|
| Molecular Weight | 430.9 |
| InChIKey | UDVVBIAUHQNQOM-UHFFFAOYSA-N |
| SMILES | CCCCn1c(N2CCN(Cc3cccc(Cl)c3)CC2)nc2c1c(=O)[nH]c(=O)n2C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 7-butyl-8-(4-(3-chlorobenzyl)piperazin-1-yl)-3-methyl-1H-purine-2,6(3H,7H)-dione? |
| A: CAS number of 7-butyl-8-(4-(3-chlorobenzyl)piperazin-1-yl)-3-methyl-1H-purine-2,6(3H,7H)-dione is 898437-27-9. |
| Q: What is the Chinese name of 898437-27-9? |
| A: Chinese name of 898437-27-9 is 898437-27-9. |
| Q: What is the InChIKey of 7-butyl-8-(4-(3-chlorobenzyl)piperazin-1-yl)-3-methyl-1H-purine-2,6(3H,7H)-dione? |
| A: InChIKey of 7-butyl-8-(4-(3-chlorobenzyl)piperazin-1-yl)-3-methyl-1H-purine-2,6(3H,7H)-dione is UDVVBIAUHQNQOM-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 7-butyl-8-(4-(3-chlorobenzyl)piperazin-1-yl)-3-methyl-1H-purine-2,6(3H,7H)-dione? |
| A: Molecular formula of 7-butyl-8-(4-(3-chlorobenzyl)piperazin-1-yl)-3-methyl-1H-purine-2,6(3H,7H)-dione is C21H27ClN6O2. |
| Q: What is the molecular weight of 7-butyl-8-(4-(3-chlorobenzyl)piperazin-1-yl)-3-methyl-1H-purine-2,6(3H,7H)-dione? |
| A: Molecular weight of 7-butyl-8-(4-(3-chlorobenzyl)piperazin-1-yl)-3-methyl-1H-purine-2,6(3H,7H)-dione is 430.9. |
| Q: What is the SMILES notation of 7-butyl-8-(4-(3-chlorobenzyl)piperazin-1-yl)-3-methyl-1H-purine-2,6(3H,7H)-dione? |
| A: SMILES notation of 7-butyl-8-(4-(3-chlorobenzyl)piperazin-1-yl)-3-methyl-1H-purine-2,6(3H,7H)-dione is CCCCn1c(N2CCN(Cc3cccc(Cl)c3)CC2)nc2c1c(=O)[nH]c(=O)n2C. |
| Q: What is the English name of 7-butyl-8-(4-(3-chlorobenzyl)piperazin-1-yl)-3-methyl-1H-purine-2,6(3H,7H)-dione? |
| A: The English name of 7-butyl-8-(4-(3-chlorobenzyl)piperazin-1-yl)-3-methyl-1H-purine-2,6(3H,7H)-dione is 7-butyl-8-(4-(3-chlorobenzyl)piperazin-1-yl)-3-methyl-1H-purine-2,6(3H,7H)-dione. |