methyl 8-chloro-2-(2,2-dimethoxyacetyl)oct-4-ynoate structure
|
Common Name | methyl 8-chloro-2-(2,2-dimethoxyacetyl)oct-4-ynoate | ||
|---|---|---|---|---|
| CAS Number | 89845-07-8 | Molecular Weight | 290.74000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19ClO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 8-chloro-2-(2,2-dimethoxyacetyl)oct-4-ynoate |
|---|
| Molecular Formula | C13H19ClO5 |
|---|---|
| Molecular Weight | 290.74000 |
| Exact Mass | 290.09200 |
| PSA | 61.83000 |
| LogP | 1.37610 |
| InChIKey | PBZZKCGPYKFZIB-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC#CCCCCl)C(=O)C(OC)OC |
|
~74%
methyl 8-chloro... CAS#:89845-07-8 |
| Literature: Ohuchida, Shuichi; Hamanaka, Nobuyuki; Hayashi, Masaki Journal of the American Chemical Society, 1981 , vol. 103, # 15 p. 4597 - 4599 |
|
~%
methyl 8-chloro... CAS#:89845-07-8 |
| Literature: Ohuchida, Shuichi; Hamanaka, Nobuyuki; Hayashi, Masaki Tetrahedron, 1983 , vol. 39, # 24 p. 4273 - 4280 |
|
~%
methyl 8-chloro... CAS#:89845-07-8 |
| Literature: Ohuchida, Shuichi; Hamanaka, Nobuyuki; Hayashi, Masaki Tetrahedron, 1983 , vol. 39, # 24 p. 4273 - 4280 |