2-bromo-1-naphthalen-1-yl-propan-1-one structure
|
Common Name | 2-bromo-1-naphthalen-1-yl-propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 89845-24-9 | Molecular Weight | 263.13000 | |
| Density | 1.421g/cm3 | Boiling Point | 355.1ºC at 760 mmHg | |
| Molecular Formula | C13H11BrO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 80.3ºC | |
| Name | 2-bromo-1-naphthalen-1-ylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.421g/cm3 |
|---|---|
| Boiling Point | 355.1ºC at 760 mmHg |
| Molecular Formula | C13H11BrO |
| Molecular Weight | 263.13000 |
| Flash Point | 80.3ºC |
| Exact Mass | 261.99900 |
| PSA | 17.07000 |
| LogP | 3.80590 |
| Index of Refraction | 1.636 |
| InChIKey | FGZJTYQVOKKPSJ-UHFFFAOYSA-N |
| SMILES | CC(Br)C(=O)c1cccc2ccccc12 |
|
~%
2-bromo-1-napht... CAS#:89845-24-9 |
| Literature: PROSIDION LIMITED Patent: WO2006/85118 A2, 2006 ; Location in patent: Page/Page column 23 ; WO 2006/085118 A2 |
|
~%
2-bromo-1-napht... CAS#:89845-24-9 |
| Literature: Kloetzel; Wildman Journal of Organic Chemistry, 1946 , vol. 11, p. 390,392 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 2-bromo-1-[1]naphthyl-propan-1-one |
| 2-bromo-1-(1-naphthyl)-1-propanone |
| 2-bromo-1-(naphth-1-yl)-1-propanone |
| 2-Brom-1-[1]naphthyl-propan-1-on |
| 2-bromo-1-naphthalen-1-yl-propan-1-one |