N-(benzenecarbonothioyl)-N-propan-2-ylbenzamide
N-(benzenecarbonothioyl)-N-propan-2-ylbenzamide structure
|
Common Name | N-(benzenecarbonothioyl)-N-propan-2-ylbenzamide | ||
|---|---|---|---|---|
| CAS Number | 89873-85-8 | Molecular Weight | 283.38800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H17NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(benzenecarbonothioyl)-N-propan-2-ylbenzamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H17NOS |
|---|---|
| Molecular Weight | 283.38800 |
| Exact Mass | 283.10300 |
| PSA | 52.40000 |
| LogP | 3.91290 |
| InChIKey | ZDGPDBXUUTUXMZ-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(=O)c1ccccc1)C(=S)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~99%
N-(benzenecarbo... CAS#:89873-85-8 |
| Literature: Sakamoto, Masami; Aoyama, Hiromu; Omote, Yoshimori Journal of Organic Chemistry, 1984 , vol. 49, # 10 p. 1837 - 1838 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-isopropyl-N-benzoylthiobenzamide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-(benzenecarbonothioyl)-N-propan-2-ylbenzamide? |
| A: CAS number of N-(benzenecarbonothioyl)-N-propan-2-ylbenzamide is 89873-85-8. |
| Q: What is the Chinese name of 89873-85-8? |
| A: Chinese name of 89873-85-8 is 89873-85-8. |
| Q: What is the InChIKey of N-(benzenecarbonothioyl)-N-propan-2-ylbenzamide? |
| A: InChIKey of N-(benzenecarbonothioyl)-N-propan-2-ylbenzamide is ZDGPDBXUUTUXMZ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of N-(benzenecarbonothioyl)-N-propan-2-ylbenzamide? |
| A: SMILES notation of N-(benzenecarbonothioyl)-N-propan-2-ylbenzamide is CC(C)N(C(=O)c1ccccc1)C(=S)c1ccccc1. |
| Q: What English synonyms does N-(benzenecarbonothioyl)-N-propan-2-ylbenzamide have? |
| A: English synonyms of N-(benzenecarbonothioyl)-N-propan-2-ylbenzamide: N-isopropyl-N-benzoylthiobenzamide. |
| Q: What is the English name of N-(benzenecarbonothioyl)-N-propan-2-ylbenzamide? |
| A: The English name of N-(benzenecarbonothioyl)-N-propan-2-ylbenzamide is N-(benzenecarbonothioyl)-N-propan-2-ylbenzamide. |
| Q: What is the polar surface area (PSA) of N-(benzenecarbonothioyl)-N-propan-2-ylbenzamide? |
| A: Polar surface area (PSA) of N-(benzenecarbonothioyl)-N-propan-2-ylbenzamide is 52.40000. |
| Q: What is the LogP of N-(benzenecarbonothioyl)-N-propan-2-ylbenzamide? |
| A: LogP of N-(benzenecarbonothioyl)-N-propan-2-ylbenzamide is 3.91290. |
| Q: What is the molecular formula of N-(benzenecarbonothioyl)-N-propan-2-ylbenzamide? |
| A: Molecular formula of N-(benzenecarbonothioyl)-N-propan-2-ylbenzamide is C17H17NOS. |
| Q: What is the molecular weight of N-(benzenecarbonothioyl)-N-propan-2-ylbenzamide? |
| A: Molecular weight of N-(benzenecarbonothioyl)-N-propan-2-ylbenzamide is 283.38800. |