ethyl 8-(3,5-dichlorophenyl)-8-oxooctanoate structure
|
Common Name | ethyl 8-(3,5-dichlorophenyl)-8-oxooctanoate | ||
|---|---|---|---|---|
| CAS Number | 898751-96-7 | Molecular Weight | 331.23400 | |
| Density | 1.181g/cm3 | Boiling Point | 431.4ºC at 760 mmHg | |
| Molecular Formula | C16H20Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.8ºC | |
| Name | ethyl 8-(3,5-dichlorophenyl)-8-oxooctanoate |
|---|
| Density | 1.181g/cm3 |
|---|---|
| Boiling Point | 431.4ºC at 760 mmHg |
| Molecular Formula | C16H20Cl2O3 |
| Molecular Weight | 331.23400 |
| Flash Point | 156.8ºC |
| Exact Mass | 330.07900 |
| PSA | 43.37000 |
| LogP | 5.07980 |
| Index of Refraction | 1.517 |
| InChIKey | DHGJFGLDTVZCJV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCCCCC(=O)c1cc(Cl)cc(Cl)c1 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |