Ethyl 6-(3-methoxyphenyl)-6-oxohexanoate structure
|
Common Name | Ethyl 6-(3-methoxyphenyl)-6-oxohexanoate | ||
|---|---|---|---|---|
| CAS Number | 898752-02-8 | Molecular Weight | 264.31700 | |
| Density | 1.068g/cm3 | Boiling Point | 372.3ºC at 760 mmHg | |
| Molecular Formula | C15H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.3ºC | |
| Name | Ethyl 6-(3-methoxyphenyl)-6-oxohexanoate |
|---|
| Density | 1.068g/cm3 |
|---|---|
| Boiling Point | 372.3ºC at 760 mmHg |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.31700 |
| Flash Point | 162.3ºC |
| Exact Mass | 264.13600 |
| PSA | 52.60000 |
| LogP | 3.00140 |
| Index of Refraction | 1.497 |
| InChIKey | PTNXUCUFAUZYHP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCCC(=O)c1cccc(OC)c1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |