ethyl 7-(3,4-difluorophenyl)-7-oxoheptanoate structure
|
Common Name | ethyl 7-(3,4-difluorophenyl)-7-oxoheptanoate | ||
|---|---|---|---|---|
| CAS Number | 898752-28-8 | Molecular Weight | 284.29800 | |
| Density | 1.144g/cm3 | Boiling Point | 369ºC at 760 mmHg | |
| Molecular Formula | C15H18F2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171ºC | |
| Name | ethyl 7-(3,4-difluorophenyl)-7-oxoheptanoate |
|---|
| Density | 1.144g/cm3 |
|---|---|
| Boiling Point | 369ºC at 760 mmHg |
| Molecular Formula | C15H18F2O3 |
| Molecular Weight | 284.29800 |
| Flash Point | 171ºC |
| Exact Mass | 284.12200 |
| PSA | 43.37000 |
| LogP | 3.66110 |
| Index of Refraction | 1.479 |
| InChIKey | LCUJTEDRSISWAF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCCCC(=O)c1ccc(F)c(F)c1 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |