Ethyl 7-cyclohexyl-7-oxoheptanoate
Modify Date: 2024-02-03 09:57:25
Ethyl 7-cyclohexyl-7-oxoheptanoate structure
|
Common Name | Ethyl 7-cyclohexyl-7-oxoheptanoate | ||
|---|---|---|---|---|
| CAS Number | 898753-77-0 | Molecular Weight | 254.36500 | |
| Density | 0.99g/cm3 | Boiling Point | 361.2ºC at 760 mmHg | |
| Molecular Formula | C15H26O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156ºC | |
| Name | Ethyl 7-cyclohexyl-7-oxoheptanoate |
|---|
| Density | 0.99g/cm3 |
|---|---|
| Boiling Point | 361.2ºC at 760 mmHg |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.36500 |
| Flash Point | 156ºC |
| Exact Mass | 254.18800 |
| PSA | 43.37000 |
| LogP | 3.64940 |
| Index of Refraction | 1.465 |
| InChIKey | CGLXGLVLRGHIRH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCCCC(=O)C1CCCCC1 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |