2',4'-DIMETHOXY-4-(5,5-DIMETHYL-1,3-DIOXAN-2-YL)BUTYROPHENONE structure
|
Common Name | 2',4'-DIMETHOXY-4-(5,5-DIMETHYL-1,3-DIOXAN-2-YL)BUTYROPHENONE | ||
|---|---|---|---|---|
| CAS Number | 898756-06-4 | Molecular Weight | 322.39600 | |
| Density | 1.057g/cm3 | Boiling Point | 450.3ºC at 760 mmHg | |
| Molecular Formula | C18H26O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.7ºC | |
| Name | 1-(2,4-dimethoxyphenyl)-4-(5,5-dimethyl-1,3-dioxan-2-yl)butan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.057g/cm3 |
|---|---|
| Boiling Point | 450.3ºC at 760 mmHg |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.39600 |
| Flash Point | 196.7ºC |
| Exact Mass | 322.17800 |
| PSA | 53.99000 |
| LogP | 3.45590 |
| Index of Refraction | 1.488 |
| InChIKey | ITXQQPMXQZCBBD-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)CCCC2OCC(C)(C)CO2)c(OC)c1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2',4'-dimethoxy-4-(5,5-dimethyl-1,3-dioxan-2-yl)butyrophenone |