ethyl 6-(2,3-dimethoxyphenyl)-6-oxohexanoate structure
|
Common Name | ethyl 6-(2,3-dimethoxyphenyl)-6-oxohexanoate | ||
|---|---|---|---|---|
| CAS Number | 898758-09-3 | Molecular Weight | 294.34300 | |
| Density | 1.084g/cm3 | Boiling Point | 393.9ºC at 760 mmHg | |
| Molecular Formula | C16H22O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.8ºC | |
| Name | ethyl 6-(2,3-dimethoxyphenyl)-6-oxohexanoate |
|---|
| Density | 1.084g/cm3 |
|---|---|
| Boiling Point | 393.9ºC at 760 mmHg |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.34300 |
| Flash Point | 191.8ºC |
| Exact Mass | 294.14700 |
| PSA | 61.83000 |
| LogP | 3.01000 |
| Index of Refraction | 1.495 |
| InChIKey | VTOXEPDKBMTDEP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCCC(=O)c1cccc(OC)c1OC |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |