3'-(1,3-DIOXOLAN-2-YL)-2-FLUOROBENZOPHENONE structure
|
Common Name | 3'-(1,3-DIOXOLAN-2-YL)-2-FLUOROBENZOPHENONE | ||
|---|---|---|---|---|
| CAS Number | 898759-28-9 | Molecular Weight | 272.27100 | |
| Density | 1.252g/cm3 | Boiling Point | 436.5ºC at 760 mmHg | |
| Molecular Formula | C16H13FO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.1ºC | |
| Name | [3-(1,3-dioxolan-2-yl)phenyl]-(2-fluorophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.252g/cm3 |
|---|---|
| Boiling Point | 436.5ºC at 760 mmHg |
| Molecular Formula | C16H13FO3 |
| Molecular Weight | 272.27100 |
| Flash Point | 210.1ºC |
| Exact Mass | 272.08500 |
| PSA | 35.53000 |
| LogP | 3.10210 |
| Index of Refraction | 1.569 |
| InChIKey | CANVVOWCIOAPLR-UHFFFAOYSA-N |
| SMILES | O=C(c1cccc(C2OCCO2)c1)c1ccccc1F |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3'-(1,3-dioxolan-2-yl)-2-fluorobenzophenone |